* #27232: jni: added pjproject checkout as regular git content
We will remove it once the next release of pjsip (with Android support)
comes out and is merged into SFLphone.
diff --git a/jni/pjproject-android/.svn/pristine/9f/9f0a19dbf32814297a0ce0c2728dc7c576267834.svn-base b/jni/pjproject-android/.svn/pristine/9f/9f0a19dbf32814297a0ce0c2728dc7c576267834.svn-base
new file mode 100644
index 0000000..7dafd52
--- /dev/null
+++ b/jni/pjproject-android/.svn/pristine/9f/9f0a19dbf32814297a0ce0c2728dc7c576267834.svn-base
@@ -0,0 +1,125 @@
+# $Id$
+import time
+import imp
+import sys
+import inc_const as const
+from inc_cfg import *
+
+# Load configuration
+cfg_file = imp.load_source("cfg_file", ARGS[1])
+
+
+# Test body function
+def test_func(t):
+ u1 = t.process[0]
+ uri1 = cfg_file.test_param.inst_params[0].uri
+ acc1 = "-1"
+ u2 = t.process[1]
+ uri2 = cfg_file.test_param.inst_params[1].uri
+ acc2 = "-1"
+
+ # if have_reg then wait for couple of seconds for PUBLISH
+ # to complete (just in case pUBLISH is used)
+ if u1.inst_param.have_reg:
+ time.sleep(1)
+ if u2.inst_param.have_reg:
+ time.sleep(1)
+
+ # U1 adds U2 as buddy
+ u1.send("+b")
+ u1.send(uri2)
+ u1.expect("Subscription state changed NULL --> SENT")
+ u1.expect("Presence subscription.*is ACCEPTED")
+ if not u2.inst_param.have_publish:
+ # Process incoming SUBSCRIBE in U2
+ # Finds out which account gets the subscription in U2
+ line = u2.expect("pjsua_pres.*subscription.*using account")
+ acc2 = line.split("using account ")[1]
+ # wait until we've got Online notification
+ u1.expect(uri2 + ".*Online")
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # U2 adds U1 as buddy
+ u2.send("+b")
+ u2.send(uri1)
+ u2.expect("Subscription state changed NULL --> SENT")
+ u2.expect("Presence subscription.*is ACCEPTED")
+ if not u1.inst_param.have_publish:
+ # Process incoming SUBSCRIBE in U1
+ # Finds out which account gets the subscription in U1
+ line = u1.expect("pjsua_pres.*subscription.*using account")
+ acc1 = line.split("using account ")[1]
+ # wait until we've got Online notification
+ u2.expect(uri1 + ".*Online")
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # Set current account in both U1 and U2
+ if acc1!="-1":
+ u1.send(">")
+ u1.send(acc1)
+ u1.expect("Current account changed")
+ if acc2!="-1":
+ u2.send(">")
+ u2.send(acc2)
+ u2.expect("Current account changed")
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # u2 toggles online status
+ u2.send("t")
+ u1.expect(uri2 + ".*status.*Offline")
+ u2.expect("offline")
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # u1 toggles online status
+ u1.send("t")
+ u2.expect(uri1 + ".*status.*Offline")
+ u1.expect("offline")
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # u2 set online status to On the phone
+ u2.send("T")
+ u2.send("3")
+ u1.expect(uri2 + ".*status.*On the phone")
+ u2.expect("On the phone")
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+ # U1 send IM
+ im_text = "Hello World from U1"
+ u1.send("i")
+ u1.send(uri2)
+ u2.expect(" is typing")
+ u1.send(im_text)
+ u1.expect(im_text+".*delivered successfully")
+ u2.expect("MESSAGE from.*"+im_text)
+
+ # Synchronize stdout
+ u1.sync_stdout()
+ u2.sync_stdout()
+
+
+# Here where it all comes together
+test = cfg_file.test_param
+test.test_func = test_func
+
diff --git a/jni/pjproject-android/.svn/pristine/9f/9f347f756fb3686e8ceeb1afba2719cb4e55b99e.svn-base b/jni/pjproject-android/.svn/pristine/9f/9f347f756fb3686e8ceeb1afba2719cb4e55b99e.svn-base
new file mode 100644
index 0000000..c2f9f9a
--- /dev/null
+++ b/jni/pjproject-android/.svn/pristine/9f/9f347f756fb3686e8ceeb1afba2719cb4e55b99e.svn-base
@@ -0,0 +1,1054 @@
+/* $Id$ */
+/*
+ * Copyright (C) 2008-2011 Teluu Inc. (http://www.teluu.com)
+ * Copyright (C) 2003-2008 Benny Prijono <benny@prijono.org>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+#include <pjmedia-codec/passthrough.h>
+#include <pjmedia-codec/amr_sdp_match.h>
+#include <pjmedia/codec.h>
+#include <pjmedia/errno.h>
+#include <pjmedia/endpoint.h>
+#include <pjmedia/port.h>
+#include <pj/assert.h>
+#include <pj/log.h>
+#include <pj/math.h>
+#include <pj/pool.h>
+#include <pj/string.h>
+#include <pj/os.h>
+
+/*
+ * Only build this file if PJMEDIA_HAS_PASSTHROUGH_CODECS != 0
+ */
+#if defined(PJMEDIA_HAS_PASSTHROUGH_CODECS) && PJMEDIA_HAS_PASSTHROUGH_CODECS!=0
+
+#define THIS_FILE "passthrough.c"
+
+
+/* Prototypes for passthrough codecs factory */
+static pj_status_t test_alloc( pjmedia_codec_factory *factory,
+ const pjmedia_codec_info *id );
+static pj_status_t default_attr( pjmedia_codec_factory *factory,
+ const pjmedia_codec_info *id,
+ pjmedia_codec_param *attr );
+static pj_status_t enum_codecs( pjmedia_codec_factory *factory,
+ unsigned *count,
+ pjmedia_codec_info codecs[]);
+static pj_status_t alloc_codec( pjmedia_codec_factory *factory,
+ const pjmedia_codec_info *id,
+ pjmedia_codec **p_codec);
+static pj_status_t dealloc_codec( pjmedia_codec_factory *factory,
+ pjmedia_codec *codec );
+
+/* Prototypes for passthrough codecs implementation. */
+static pj_status_t codec_init( pjmedia_codec *codec,
+ pj_pool_t *pool );
+static pj_status_t codec_open( pjmedia_codec *codec,
+ pjmedia_codec_param *attr );
+static pj_status_t codec_close( pjmedia_codec *codec );
+static pj_status_t codec_modify(pjmedia_codec *codec,
+ const pjmedia_codec_param *attr );
+static pj_status_t codec_parse( pjmedia_codec *codec,
+ void *pkt,
+ pj_size_t pkt_size,
+ const pj_timestamp *ts,
+ unsigned *frame_cnt,
+ pjmedia_frame frames[]);
+static pj_status_t codec_encode( pjmedia_codec *codec,
+ const struct pjmedia_frame *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output);
+static pj_status_t codec_decode( pjmedia_codec *codec,
+ const struct pjmedia_frame *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output);
+static pj_status_t codec_recover( pjmedia_codec *codec,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output);
+
+/* Definition for passthrough codecs operations. */
+static pjmedia_codec_op codec_op =
+{
+ &codec_init,
+ &codec_open,
+ &codec_close,
+ &codec_modify,
+ &codec_parse,
+ &codec_encode,
+ &codec_decode,
+ &codec_recover
+};
+
+/* Definition for passthrough codecs factory operations. */
+static pjmedia_codec_factory_op codec_factory_op =
+{
+ &test_alloc,
+ &default_attr,
+ &enum_codecs,
+ &alloc_codec,
+ &dealloc_codec,
+ &pjmedia_codec_passthrough_deinit
+};
+
+/* Passthrough codecs factory */
+static struct codec_factory {
+ pjmedia_codec_factory base;
+ pjmedia_endpt *endpt;
+ pj_pool_t *pool;
+ pj_mutex_t *mutex;
+} codec_factory;
+
+/* Passthrough codecs private data. */
+typedef struct codec_private {
+ pj_pool_t *pool; /**< Pool for each instance. */
+ int codec_idx; /**< Codec index. */
+ void *codec_setting; /**< Specific codec setting. */
+ pj_uint16_t avg_frame_size; /**< Average of frame size. */
+ unsigned samples_per_frame; /**< Samples per frame, for iLBC
+ this can be 240 or 160, can
+ only be known after codec is
+ opened. */
+} codec_private_t;
+
+
+
+/* CUSTOM CALLBACKS */
+
+/* Parse frames from a packet. Default behaviour of frame parsing is
+ * just separating frames based on calculating frame length derived
+ * from bitrate. Implement this callback when the default behaviour is
+ * unapplicable.
+ */
+typedef pj_status_t (*parse_cb)(codec_private_t *codec_data, void *pkt,
+ pj_size_t pkt_size, const pj_timestamp *ts,
+ unsigned *frame_cnt, pjmedia_frame frames[]);
+
+/* Pack frames into a packet. Default behaviour of packing frames is
+ * just stacking the frames with octet aligned without adding any
+ * payload header. Implement this callback when the default behaviour is
+ * unapplicable.
+ */
+typedef pj_status_t (*pack_cb)(codec_private_t *codec_data,
+ const struct pjmedia_frame_ext *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output);
+
+
+/* Custom callback implementations. */
+static pj_status_t parse_amr( codec_private_t *codec_data, void *pkt,
+ pj_size_t pkt_size, const pj_timestamp *ts,
+ unsigned *frame_cnt, pjmedia_frame frames[]);
+static pj_status_t pack_amr ( codec_private_t *codec_data,
+ const struct pjmedia_frame_ext *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output);
+
+
+/* Passthrough codec implementation descriptions. */
+static struct codec_desc {
+ int enabled; /* Is this codec enabled? */
+ const char *name; /* Codec name. */
+ pj_uint8_t pt; /* Payload type. */
+ pjmedia_format_id fmt_id; /* Source format. */
+ unsigned clock_rate; /* Codec's clock rate. */
+ unsigned channel_count; /* Codec's channel count. */
+ unsigned samples_per_frame; /* Codec's samples count. */
+ unsigned def_bitrate; /* Default bitrate of this codec. */
+ unsigned max_bitrate; /* Maximum bitrate of this codec. */
+ pj_uint8_t frm_per_pkt; /* Default num of frames per packet.*/
+ pj_uint8_t vad; /* VAD enabled/disabled. */
+ pj_uint8_t plc; /* PLC enabled/disabled. */
+ parse_cb parse; /* Callback to parse bitstream. */
+ pack_cb pack; /* Callback to pack bitstream. */
+ pjmedia_codec_fmtp dec_fmtp; /* Decoder's fmtp params. */
+}
+
+codec_desc[] =
+{
+# if PJMEDIA_HAS_PASSTHROUGH_CODEC_AMR
+ {1, "AMR", PJMEDIA_RTP_PT_AMR, PJMEDIA_FORMAT_AMR,
+ 8000, 1, 160,
+ 7400, 12200, 2, 1, 1,
+ &parse_amr, &pack_amr
+ /*, {1, {{{"octet-align", 11}, {"1", 1}}} } */
+ },
+# endif
+
+# if PJMEDIA_HAS_PASSTHROUGH_CODEC_G729
+ {1, "G729", PJMEDIA_RTP_PT_G729, PJMEDIA_FORMAT_G729,
+ 8000, 1, 80,
+ 8000, 8000, 2, 1, 1
+ },
+# endif
+
+# if PJMEDIA_HAS_PASSTHROUGH_CODEC_ILBC
+ {1, "iLBC", PJMEDIA_RTP_PT_ILBC, PJMEDIA_FORMAT_ILBC,
+ 8000, 1, 240,
+ 13333, 15200, 1, 1, 1,
+ NULL, NULL,
+ {1, {{{"mode", 4}, {"30", 2}}} }
+ },
+# endif
+
+# if PJMEDIA_HAS_PASSTHROUGH_CODEC_PCMU
+ {1, "PCMU", PJMEDIA_RTP_PT_PCMU, PJMEDIA_FORMAT_PCMU,
+ 8000, 1, 80,
+ 64000, 64000, 2, 1, 1
+ },
+# endif
+
+# if PJMEDIA_HAS_PASSTHROUGH_CODEC_PCMA
+ {1, "PCMA", PJMEDIA_RTP_PT_PCMA, PJMEDIA_FORMAT_PCMA,
+ 8000, 1, 80,
+ 64000, 64000, 2, 1, 1
+ },
+# endif
+};
+
+
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_AMR
+
+#include <pjmedia-codec/amr_helper.h>
+
+typedef struct amr_settings_t {
+ pjmedia_codec_amr_pack_setting enc_setting;
+ pjmedia_codec_amr_pack_setting dec_setting;
+ pj_int8_t enc_mode;
+} amr_settings_t;
+
+
+/* Pack AMR payload */
+static pj_status_t pack_amr ( codec_private_t *codec_data,
+ const struct pjmedia_frame_ext *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output)
+{
+ enum {MAX_FRAMES_PER_PACKET = PJMEDIA_MAX_FRAME_DURATION_MS / 20};
+
+ pjmedia_frame frames[MAX_FRAMES_PER_PACKET];
+ amr_settings_t* setting = (amr_settings_t*)codec_data->codec_setting;
+ pjmedia_codec_amr_pack_setting *enc_setting = &setting->enc_setting;
+ pj_uint8_t SID_FT;
+ unsigned i;
+
+ pj_assert(input->subframe_cnt <= MAX_FRAMES_PER_PACKET);
+
+ SID_FT = (pj_uint8_t)(enc_setting->amr_nb? 8 : 9);
+
+ /* Get frames */
+ for (i = 0; i < input->subframe_cnt; ++i) {
+ pjmedia_frame_ext_subframe *sf;
+ pjmedia_codec_amr_bit_info *info;
+ unsigned len;
+
+ sf = pjmedia_frame_ext_get_subframe(input, i);
+ len = (sf->bitlen + 7) >> 3;
+
+ info = (pjmedia_codec_amr_bit_info*) &frames[i].bit_info;
+ pj_bzero(info, sizeof(*info));
+
+ if (len == 0) {
+ /* DTX */
+ info->frame_type = 15;
+ } else {
+ info->frame_type = pjmedia_codec_amr_get_mode2(enc_setting->amr_nb,
+ len);
+ }
+ info->good_quality = 1;
+ info->mode = setting->enc_mode;
+ if (info->frame_type == SID_FT)
+ info->STI = (sf->data[4] >> 4) & 1;
+
+ frames[i].buf = sf->data;
+ frames[i].size = len;
+ }
+
+ output->size = output_buf_len;
+
+ return pjmedia_codec_amr_pack(frames, input->subframe_cnt, enc_setting,
+ output->buf, &output->size);
+}
+
+
+/* Parse AMR payload into frames. */
+static pj_status_t parse_amr(codec_private_t *codec_data, void *pkt,
+ pj_size_t pkt_size, const pj_timestamp *ts,
+ unsigned *frame_cnt, pjmedia_frame frames[])
+{
+ amr_settings_t* s = (amr_settings_t*)codec_data->codec_setting;
+ pjmedia_codec_amr_pack_setting *setting;
+ pj_status_t status;
+ pj_uint8_t cmr;
+
+ setting = &s->dec_setting;
+
+ status = pjmedia_codec_amr_parse(pkt, pkt_size, ts, setting, frames,
+ frame_cnt, &cmr);
+ if (status != PJ_SUCCESS)
+ return status;
+
+ // CMR is not supported for now.
+ /* Check Change Mode Request. */
+ //if ((setting->amr_nb && cmr <= 7) || (!setting->amr_nb && cmr <= 8)) {
+ // s->enc_mode = cmr;
+ //}
+
+ return PJ_SUCCESS;
+}
+
+#endif /* PJMEDIA_HAS_PASSTROUGH_CODEC_AMR */
+
+
+/*
+ * Initialize and register passthrough codec factory to pjmedia endpoint.
+ */
+PJ_DEF(pj_status_t) pjmedia_codec_passthrough_init( pjmedia_endpt *endpt )
+{
+ pjmedia_codec_mgr *codec_mgr;
+ pj_str_t codec_name;
+ pj_status_t status;
+
+ if (codec_factory.pool != NULL) {
+ /* Already initialized. */
+ return PJ_EEXISTS;
+ }
+
+ /* Create passthrough codec factory. */
+ codec_factory.base.op = &codec_factory_op;
+ codec_factory.base.factory_data = NULL;
+ codec_factory.endpt = endpt;
+
+ codec_factory.pool = pjmedia_endpt_create_pool(endpt, "Passthrough codecs",
+ 4000, 4000);
+ if (!codec_factory.pool)
+ return PJ_ENOMEM;
+
+ /* Create mutex. */
+ status = pj_mutex_create_simple(codec_factory.pool, "Passthrough codecs",
+ &codec_factory.mutex);
+ if (status != PJ_SUCCESS)
+ goto on_error;
+
+ /* Get the codec manager. */
+ codec_mgr = pjmedia_endpt_get_codec_mgr(endpt);
+ if (!codec_mgr) {
+ status = PJ_EINVALIDOP;
+ goto on_error;
+ }
+
+ /* Register format match callback. */
+#if PJMEDIA_HAS_PASSTROUGH_CODEC_AMR
+ pj_cstr(&codec_name, "AMR");
+ status = pjmedia_sdp_neg_register_fmt_match_cb(
+ &codec_name,
+ &pjmedia_codec_amr_match_sdp);
+ if (status != PJ_SUCCESS)
+ goto on_error;
+#endif
+
+ /* Suppress compile warning */
+ PJ_UNUSED_ARG(codec_name);
+
+ /* Register codec factory to endpoint. */
+ status = pjmedia_codec_mgr_register_factory(codec_mgr,
+ &codec_factory.base);
+ if (status != PJ_SUCCESS)
+ goto on_error;
+
+ /* Done. */
+ return PJ_SUCCESS;
+
+on_error:
+ pj_pool_release(codec_factory.pool);
+ codec_factory.pool = NULL;
+ return status;
+}
+
+/*
+ * Initialize and register passthrough codec factory to pjmedia endpoint.
+ */
+PJ_DEF(pj_status_t) pjmedia_codec_passthrough_init2(
+ pjmedia_endpt *endpt,
+ const pjmedia_codec_passthrough_setting *setting)
+{
+ if (codec_factory.pool != NULL) {
+ /* Already initialized. */
+ return PJ_EEXISTS;
+ }
+
+ if (setting != NULL) {
+ unsigned i;
+
+ /* Enable/disable codecs based on the specified encoding formats */
+ for (i = 0; i < PJ_ARRAY_SIZE(codec_desc); ++i) {
+ pj_bool_t enabled = PJ_FALSE;
+ unsigned j;
+
+ for (j = 0; j < setting->fmt_cnt && !enabled; ++j) {
+ if ((pj_uint32_t)codec_desc[i].fmt_id == setting->fmts[j].id)
+ enabled = PJ_TRUE;
+ }
+
+ codec_desc[i].enabled = enabled;
+ }
+
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_ILBC
+ /* Update iLBC codec description based on default mode setting. */
+ for (i = 0; i < PJ_ARRAY_SIZE(codec_desc); ++i) {
+ if (codec_desc[i].enabled &&
+ codec_desc[i].fmt_id == PJMEDIA_FORMAT_ILBC)
+ {
+ codec_desc[i].samples_per_frame =
+ (setting->ilbc_mode == 20? 160 : 240);
+ codec_desc[i].def_bitrate =
+ (setting->ilbc_mode == 20? 15200 : 13333);
+ pj_strset2(&codec_desc[i].dec_fmtp.param[0].val,
+ (setting->ilbc_mode == 20? "20" : "30"));
+ break;
+ }
+ }
+#endif
+ }
+
+ return pjmedia_codec_passthrough_init(endpt);
+}
+
+/*
+ * Unregister passthrough codecs factory from pjmedia endpoint.
+ */
+PJ_DEF(pj_status_t) pjmedia_codec_passthrough_deinit(void)
+{
+ pjmedia_codec_mgr *codec_mgr;
+ unsigned i;
+ pj_status_t status;
+
+ if (codec_factory.pool == NULL) {
+ /* Already deinitialized */
+ return PJ_SUCCESS;
+ }
+
+ pj_mutex_lock(codec_factory.mutex);
+
+ /* Get the codec manager. */
+ codec_mgr = pjmedia_endpt_get_codec_mgr(codec_factory.endpt);
+ if (!codec_mgr) {
+ pj_pool_release(codec_factory.pool);
+ codec_factory.pool = NULL;
+ return PJ_EINVALIDOP;
+ }
+
+ /* Unregister passthrough codecs factory. */
+ status = pjmedia_codec_mgr_unregister_factory(codec_mgr,
+ &codec_factory.base);
+
+ /* Destroy mutex. */
+ pj_mutex_destroy(codec_factory.mutex);
+
+ /* Destroy pool. */
+ pj_pool_release(codec_factory.pool);
+ codec_factory.pool = NULL;
+
+ /* Re-enable all codecs in the codec_desc. */
+ for (i = 0; i < PJ_ARRAY_SIZE(codec_desc); ++i) {
+ codec_desc[i].enabled = PJ_TRUE;
+ }
+
+ return status;
+}
+
+/*
+ * Check if factory can allocate the specified codec.
+ */
+static pj_status_t test_alloc( pjmedia_codec_factory *factory,
+ const pjmedia_codec_info *info )
+{
+ unsigned i;
+
+ PJ_UNUSED_ARG(factory);
+
+ /* Type MUST be audio. */
+ if (info->type != PJMEDIA_TYPE_AUDIO)
+ return PJMEDIA_CODEC_EUNSUP;
+
+ for (i = 0; i < PJ_ARRAY_SIZE(codec_desc); ++i) {
+ pj_str_t name = pj_str((char*)codec_desc[i].name);
+ if ((pj_stricmp(&info->encoding_name, &name) == 0) &&
+ (info->clock_rate == (unsigned)codec_desc[i].clock_rate) &&
+ (info->channel_cnt == (unsigned)codec_desc[i].channel_count) &&
+ (codec_desc[i].enabled))
+ {
+ return PJ_SUCCESS;
+ }
+ }
+
+ /* Unsupported, or mode is disabled. */
+ return PJMEDIA_CODEC_EUNSUP;
+}
+
+/*
+ * Generate default attribute.
+ */
+static pj_status_t default_attr ( pjmedia_codec_factory *factory,
+ const pjmedia_codec_info *id,
+ pjmedia_codec_param *attr )
+{
+ unsigned i;
+
+ PJ_ASSERT_RETURN(factory==&codec_factory.base, PJ_EINVAL);
+
+ pj_bzero(attr, sizeof(pjmedia_codec_param));
+
+ for (i = 0; i < PJ_ARRAY_SIZE(codec_desc); ++i) {
+ pj_str_t name = pj_str((char*)codec_desc[i].name);
+ if ((pj_stricmp(&id->encoding_name, &name) == 0) &&
+ (id->clock_rate == (unsigned)codec_desc[i].clock_rate) &&
+ (id->channel_cnt == (unsigned)codec_desc[i].channel_count) &&
+ (id->pt == (unsigned)codec_desc[i].pt))
+ {
+ attr->info.pt = (pj_uint8_t)id->pt;
+ attr->info.channel_cnt = codec_desc[i].channel_count;
+ attr->info.clock_rate = codec_desc[i].clock_rate;
+ attr->info.avg_bps = codec_desc[i].def_bitrate;
+ attr->info.max_bps = codec_desc[i].max_bitrate;
+ attr->info.pcm_bits_per_sample = 16;
+ attr->info.frm_ptime = (pj_uint16_t)
+ (codec_desc[i].samples_per_frame * 1000 /
+ codec_desc[i].channel_count /
+ codec_desc[i].clock_rate);
+ attr->info.fmt_id = codec_desc[i].fmt_id;
+
+ /* Default flags. */
+ attr->setting.frm_per_pkt = codec_desc[i].frm_per_pkt;
+ attr->setting.plc = codec_desc[i].plc;
+ attr->setting.penh= 0;
+ attr->setting.vad = codec_desc[i].vad;
+ attr->setting.cng = attr->setting.vad;
+ attr->setting.dec_fmtp = codec_desc[i].dec_fmtp;
+
+ if (attr->setting.vad == 0) {
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_G729
+ if (id->pt == PJMEDIA_RTP_PT_G729) {
+ /* Signal G729 Annex B is being disabled */
+ attr->setting.dec_fmtp.cnt = 1;
+ pj_strset2(&attr->setting.dec_fmtp.param[0].name, "annexb");
+ pj_strset2(&attr->setting.dec_fmtp.param[0].val, "no");
+ }
+#endif
+ }
+
+ return PJ_SUCCESS;
+ }
+ }
+
+ return PJMEDIA_CODEC_EUNSUP;
+}
+
+/*
+ * Enum codecs supported by this factory.
+ */
+static pj_status_t enum_codecs( pjmedia_codec_factory *factory,
+ unsigned *count,
+ pjmedia_codec_info codecs[])
+{
+ unsigned max;
+ unsigned i;
+
+ PJ_UNUSED_ARG(factory);
+ PJ_ASSERT_RETURN(codecs && *count > 0, PJ_EINVAL);
+
+ max = *count;
+
+ for (i = 0, *count = 0; i < PJ_ARRAY_SIZE(codec_desc) && *count < max; ++i)
+ {
+ if (!codec_desc[i].enabled)
+ continue;
+
+ pj_bzero(&codecs[*count], sizeof(pjmedia_codec_info));
+ codecs[*count].encoding_name = pj_str((char*)codec_desc[i].name);
+ codecs[*count].pt = codec_desc[i].pt;
+ codecs[*count].type = PJMEDIA_TYPE_AUDIO;
+ codecs[*count].clock_rate = codec_desc[i].clock_rate;
+ codecs[*count].channel_cnt = codec_desc[i].channel_count;
+
+ ++*count;
+ }
+
+ return PJ_SUCCESS;
+}
+
+/*
+ * Allocate a new codec instance.
+ */
+static pj_status_t alloc_codec( pjmedia_codec_factory *factory,
+ const pjmedia_codec_info *id,
+ pjmedia_codec **p_codec)
+{
+ codec_private_t *codec_data;
+ pjmedia_codec *codec;
+ int idx;
+ pj_pool_t *pool;
+ unsigned i;
+
+ PJ_ASSERT_RETURN(factory && id && p_codec, PJ_EINVAL);
+ PJ_ASSERT_RETURN(factory == &codec_factory.base, PJ_EINVAL);
+
+ pj_mutex_lock(codec_factory.mutex);
+
+ /* Find codec's index */
+ idx = -1;
+ for (i = 0; i < PJ_ARRAY_SIZE(codec_desc); ++i) {
+ pj_str_t name = pj_str((char*)codec_desc[i].name);
+ if ((pj_stricmp(&id->encoding_name, &name) == 0) &&
+ (id->clock_rate == (unsigned)codec_desc[i].clock_rate) &&
+ (id->channel_cnt == (unsigned)codec_desc[i].channel_count) &&
+ (codec_desc[i].enabled))
+ {
+ idx = i;
+ break;
+ }
+ }
+ if (idx == -1) {
+ *p_codec = NULL;
+ return PJMEDIA_CODEC_EUNSUP;
+ }
+
+ /* Create pool for codec instance */
+ pool = pjmedia_endpt_create_pool(codec_factory.endpt, "passthroughcodec",
+ 512, 512);
+ codec = PJ_POOL_ZALLOC_T(pool, pjmedia_codec);
+ codec->op = &codec_op;
+ codec->factory = factory;
+ codec->codec_data = PJ_POOL_ZALLOC_T(pool, codec_private_t);
+ codec_data = (codec_private_t*) codec->codec_data;
+ codec_data->pool = pool;
+ codec_data->codec_idx = idx;
+
+ pj_mutex_unlock(codec_factory.mutex);
+
+ *p_codec = codec;
+ return PJ_SUCCESS;
+}
+
+/*
+ * Free codec.
+ */
+static pj_status_t dealloc_codec( pjmedia_codec_factory *factory,
+ pjmedia_codec *codec )
+{
+ codec_private_t *codec_data;
+
+ PJ_ASSERT_RETURN(factory && codec, PJ_EINVAL);
+ PJ_ASSERT_RETURN(factory == &codec_factory.base, PJ_EINVAL);
+
+ /* Close codec, if it's not closed. */
+ codec_data = (codec_private_t*) codec->codec_data;
+ codec_close(codec);
+
+ pj_pool_release(codec_data->pool);
+
+ return PJ_SUCCESS;
+}
+
+/*
+ * Init codec.
+ */
+static pj_status_t codec_init( pjmedia_codec *codec,
+ pj_pool_t *pool )
+{
+ PJ_UNUSED_ARG(codec);
+ PJ_UNUSED_ARG(pool);
+ return PJ_SUCCESS;
+}
+
+/*
+ * Open codec.
+ */
+static pj_status_t codec_open( pjmedia_codec *codec,
+ pjmedia_codec_param *attr )
+{
+ codec_private_t *codec_data = (codec_private_t*) codec->codec_data;
+ struct codec_desc *desc = &codec_desc[codec_data->codec_idx];
+ pj_pool_t *pool;
+ int i, j;
+
+ pool = codec_data->pool;
+
+ /* Cache samples per frame value */
+ codec_data->samples_per_frame = desc->samples_per_frame;
+
+ /* Calculate bitstream size */
+ i = attr->info.avg_bps * codec_data->samples_per_frame;
+ j = desc->clock_rate << 3;
+ codec_data->avg_frame_size = (pj_uint16_t)(i / j);
+ if (i % j) ++codec_data->avg_frame_size;
+
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_AMR
+ /* Init AMR settings */
+ if (desc->pt == PJMEDIA_RTP_PT_AMR || desc->pt == PJMEDIA_RTP_PT_AMRWB) {
+ amr_settings_t *s;
+ pj_uint8_t octet_align = 0;
+ pj_int8_t enc_mode;
+
+ enc_mode = pjmedia_codec_amr_get_mode(attr->info.avg_bps);
+ pj_assert(enc_mode >= 0 && enc_mode <= 8);
+
+ for (i = 0; i < attr->setting.dec_fmtp.cnt; ++i) {
+ const pj_str_t STR_FMTP_OCTET_ALIGN = {"octet-align", 11};
+
+ /* Fetch octet-align setting. It should be fine to fetch only
+ * the decoder, since encoder & decoder must use the same setting
+ * (RFC 4867 section 8.3.1).
+ */
+ if (pj_stricmp(&attr->setting.dec_fmtp.param[i].name,
+ &STR_FMTP_OCTET_ALIGN) == 0)
+ {
+ octet_align=(pj_uint8_t)
+ (pj_strtoul(&attr->setting.dec_fmtp.param[i].val));
+ break;
+ }
+ }
+
+ for (i = 0; i < attr->setting.enc_fmtp.cnt; ++i) {
+ const pj_str_t STR_FMTP_MODE_SET = {"mode-set", 8};
+
+ /* mode-set, encoding mode is chosen based on local default mode
+ * setting:
+ * - if local default mode is included in the mode-set, use it
+ * - otherwise, find the closest mode to local default mode;
+ * if there are two closest modes, prefer to use the higher
+ * one, e.g: local default mode is 4, the mode-set param
+ * contains '2,3,5,6', then 5 will be chosen.
+ */
+ if (pj_stricmp(&attr->setting.enc_fmtp.param[i].name,
+ &STR_FMTP_MODE_SET) == 0)
+ {
+ const char *p;
+ pj_size_t l;
+ pj_int8_t diff = 99;
+
+ p = pj_strbuf(&attr->setting.enc_fmtp.param[i].val);
+ l = pj_strlen(&attr->setting.enc_fmtp.param[i].val);
+
+ while (l--) {
+ if ((desc->pt==PJMEDIA_RTP_PT_AMR && *p>='0' && *p<='7') ||
+ (desc->pt==PJMEDIA_RTP_PT_AMRWB && *p>='0' && *p<='8'))
+ {
+ pj_int8_t tmp = (pj_int8_t)(*p - '0' - enc_mode);
+
+ if (PJ_ABS(diff) > PJ_ABS(tmp) ||
+ (PJ_ABS(diff) == PJ_ABS(tmp) && tmp > diff))
+ {
+ diff = tmp;
+ if (diff == 0) break;
+ }
+ }
+ ++p;
+ }
+
+ if (diff == 99)
+ return PJMEDIA_CODEC_EFAILED;
+
+ enc_mode = (pj_int8_t)(enc_mode + diff);
+
+ break;
+ }
+ }
+
+ s = PJ_POOL_ZALLOC_T(pool, amr_settings_t);
+ codec_data->codec_setting = s;
+
+ s->enc_mode = enc_mode;
+ if (s->enc_mode < 0)
+ return PJMEDIA_CODEC_EINMODE;
+
+ s->enc_setting.amr_nb = (pj_uint8_t)(desc->pt == PJMEDIA_RTP_PT_AMR);
+ s->enc_setting.octet_aligned = octet_align;
+ s->enc_setting.reorder = PJ_FALSE; /* Note this! passthrough codec
+ doesn't do sensitivity bits
+ reordering */
+ s->enc_setting.cmr = 15;
+
+ s->dec_setting.amr_nb = (pj_uint8_t)(desc->pt == PJMEDIA_RTP_PT_AMR);
+ s->dec_setting.octet_aligned = octet_align;
+ s->dec_setting.reorder = PJ_FALSE; /* Note this! passthrough codec
+ doesn't do sensitivity bits
+ reordering */
+
+ /* Return back bitrate info to application */
+ attr->info.avg_bps = s->enc_setting.amr_nb?
+ pjmedia_codec_amrnb_bitrates[s->enc_mode]:
+ pjmedia_codec_amrwb_bitrates[s->enc_mode];
+ }
+#endif
+
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_ILBC
+ /* Init iLBC settings */
+ if (desc->pt == PJMEDIA_RTP_PT_ILBC)
+ {
+ enum { DEFAULT_MODE = 30 };
+ static pj_str_t STR_MODE = {"mode", 4};
+ pj_uint16_t dec_fmtp_mode = DEFAULT_MODE,
+ enc_fmtp_mode = DEFAULT_MODE;
+
+ /* Get decoder mode */
+ for (i = 0; i < attr->setting.dec_fmtp.cnt; ++i) {
+ if (pj_stricmp(&attr->setting.dec_fmtp.param[i].name, &STR_MODE) == 0)
+ {
+ dec_fmtp_mode = (pj_uint16_t)
+ pj_strtoul(&attr->setting.dec_fmtp.param[i].val);
+ break;
+ }
+ }
+
+ /* Decoder mode must be set */
+ PJ_ASSERT_RETURN(dec_fmtp_mode == 20 || dec_fmtp_mode == 30,
+ PJMEDIA_CODEC_EINMODE);
+
+ /* Get encoder mode */
+ for (i = 0; i < attr->setting.enc_fmtp.cnt; ++i) {
+ if (pj_stricmp(&attr->setting.enc_fmtp.param[i].name, &STR_MODE) == 0)
+ {
+ enc_fmtp_mode = (pj_uint16_t)
+ pj_strtoul(&attr->setting.enc_fmtp.param[i].val);
+ break;
+ }
+ }
+
+ PJ_ASSERT_RETURN(enc_fmtp_mode==20 || enc_fmtp_mode==30,
+ PJMEDIA_CODEC_EINMODE);
+
+ /* Both sides of a bi-directional session MUST use the same "mode" value.
+ * In this point, possible values are only 20 or 30, so when encoder and
+ * decoder modes are not same, just use the default mode, it is 30.
+ */
+ if (enc_fmtp_mode != dec_fmtp_mode) {
+ enc_fmtp_mode = dec_fmtp_mode = DEFAULT_MODE;
+ PJ_LOG(4,(pool->obj_name,
+ "Normalized iLBC encoder and decoder modes to %d",
+ DEFAULT_MODE));
+ }
+
+ /* Update some attributes based on negotiated mode. */
+ attr->info.avg_bps = (dec_fmtp_mode == 30? 13333 : 15200);
+ attr->info.frm_ptime = dec_fmtp_mode;
+
+ /* Override average frame size */
+ codec_data->avg_frame_size = (dec_fmtp_mode == 30? 50 : 38);
+
+ /* Override samples per frame */
+ codec_data->samples_per_frame = (dec_fmtp_mode == 30? 240 : 160);
+ }
+#endif
+
+ return PJ_SUCCESS;
+}
+
+/*
+ * Close codec.
+ */
+static pj_status_t codec_close( pjmedia_codec *codec )
+{
+ PJ_UNUSED_ARG(codec);
+
+ return PJ_SUCCESS;
+}
+
+
+/*
+ * Modify codec settings.
+ */
+static pj_status_t codec_modify( pjmedia_codec *codec,
+ const pjmedia_codec_param *attr )
+{
+ /* Not supported yet. */
+ PJ_UNUSED_ARG(codec);
+ PJ_UNUSED_ARG(attr);
+
+ return PJ_ENOTSUP;
+}
+
+/*
+ * Get frames in the packet.
+ */
+static pj_status_t codec_parse( pjmedia_codec *codec,
+ void *pkt,
+ pj_size_t pkt_size,
+ const pj_timestamp *ts,
+ unsigned *frame_cnt,
+ pjmedia_frame frames[])
+{
+ codec_private_t *codec_data = (codec_private_t*) codec->codec_data;
+ struct codec_desc *desc = &codec_desc[codec_data->codec_idx];
+ unsigned count = 0;
+
+ PJ_ASSERT_RETURN(frame_cnt, PJ_EINVAL);
+
+ if (desc->parse != NULL) {
+ return desc->parse(codec_data, pkt, pkt_size, ts, frame_cnt, frames);
+ }
+
+ while (pkt_size >= codec_data->avg_frame_size && count < *frame_cnt) {
+ frames[count].type = PJMEDIA_FRAME_TYPE_AUDIO;
+ frames[count].buf = pkt;
+ frames[count].size = codec_data->avg_frame_size;
+ frames[count].timestamp.u64 = ts->u64 +
+ count * codec_data->samples_per_frame;
+
+ pkt = (pj_uint8_t*)pkt + codec_data->avg_frame_size;
+ pkt_size -= codec_data->avg_frame_size;
+
+ ++count;
+ }
+
+ if (pkt_size && count < *frame_cnt) {
+ frames[count].type = PJMEDIA_FRAME_TYPE_AUDIO;
+ frames[count].buf = pkt;
+ frames[count].size = pkt_size;
+ frames[count].timestamp.u64 = ts->u64 +
+ count * codec_data->samples_per_frame;
+ ++count;
+ }
+
+ *frame_cnt = count;
+ return PJ_SUCCESS;
+}
+
+/*
+ * Encode frames.
+ */
+static pj_status_t codec_encode( pjmedia_codec *codec,
+ const struct pjmedia_frame *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output)
+{
+ codec_private_t *codec_data = (codec_private_t*) codec->codec_data;
+ struct codec_desc *desc = &codec_desc[codec_data->codec_idx];
+ const pjmedia_frame_ext *input_ = (const pjmedia_frame_ext*) input;
+
+ pj_assert(input && input->type == PJMEDIA_FRAME_TYPE_EXTENDED);
+
+ if (desc->pack != NULL) {
+ desc->pack(codec_data, input_, output_buf_len, output);
+ } else {
+ if (input_->subframe_cnt == 0) {
+ /* DTX */
+ output->buf = NULL;
+ output->size = 0;
+ output->type = PJMEDIA_FRAME_TYPE_NONE;
+ } else {
+ unsigned i;
+ pj_uint8_t *p = output->buf;
+
+ output->type = PJMEDIA_FRAME_TYPE_AUDIO;
+ output->size = 0;
+
+ for (i = 0; i < input_->subframe_cnt; ++i) {
+ pjmedia_frame_ext_subframe *sf;
+ unsigned sf_len;
+
+ sf = pjmedia_frame_ext_get_subframe(input_, i);
+ pj_assert(sf);
+
+ sf_len = (sf->bitlen + 7) >> 3;
+
+ pj_memcpy(p, sf->data, sf_len);
+ p += sf_len;
+ output->size += sf_len;
+
+ /* If there is SID or DTX frame, break the loop. */
+ if (desc->pt == PJMEDIA_RTP_PT_G729 &&
+ sf_len < codec_data->avg_frame_size)
+ {
+ break;
+ }
+
+ }
+ }
+ }
+
+ output->timestamp = input->timestamp;
+
+ return PJ_SUCCESS;
+}
+
+/*
+ * Decode frame.
+ */
+static pj_status_t codec_decode( pjmedia_codec *codec,
+ const struct pjmedia_frame *input,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output)
+{
+ codec_private_t *codec_data = (codec_private_t*) codec->codec_data;
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_AMR
+ struct codec_desc *desc = &codec_desc[codec_data->codec_idx];
+#endif
+ pjmedia_frame_ext *output_ = (pjmedia_frame_ext*) output;
+
+ pj_assert(input);
+ PJ_UNUSED_ARG(output_buf_len);
+
+#if PJMEDIA_HAS_PASSTHROUGH_CODEC_AMR
+ /* Need to rearrange the AMR bitstream, since the bitstream may not be
+ * started from bit 0 or may need to be reordered from sensitivity order
+ * into encoder bits order.
+ */
+ if (desc->pt == PJMEDIA_RTP_PT_AMR || desc->pt == PJMEDIA_RTP_PT_AMRWB) {
+ pjmedia_frame input_;
+ pjmedia_codec_amr_pack_setting *setting;
+
+ setting = &((amr_settings_t*)codec_data->codec_setting)->dec_setting;
+
+ input_ = *input;
+ pjmedia_codec_amr_predecode(input, setting, &input_);
+
+ pjmedia_frame_ext_append_subframe(output_, input_.buf,
+ (pj_uint16_t)(input_.size << 3),
+ (pj_uint16_t)codec_data->samples_per_frame);
+ output->timestamp = input->timestamp;
+
+ return PJ_SUCCESS;
+ }
+#endif
+
+ pjmedia_frame_ext_append_subframe(output_, input->buf,
+ (pj_uint16_t)(input->size << 3),
+ (pj_uint16_t)codec_data->samples_per_frame);
+ output->timestamp = input->timestamp;
+
+ return PJ_SUCCESS;
+}
+
+/*
+ * Recover lost frame.
+ */
+static pj_status_t codec_recover( pjmedia_codec *codec,
+ unsigned output_buf_len,
+ struct pjmedia_frame *output)
+{
+ codec_private_t *codec_data = (codec_private_t*) codec->codec_data;
+ pjmedia_frame_ext *output_ = (pjmedia_frame_ext*) output;
+
+ PJ_UNUSED_ARG(output_buf_len);
+
+ pjmedia_frame_ext_append_subframe(output_, NULL, 0,
+ (pj_uint16_t)codec_data->samples_per_frame);
+
+ return PJ_SUCCESS;
+}
+
+#endif /* PJMEDIA_HAS_PASSTHROUGH_CODECS */
+
diff --git a/jni/pjproject-android/.svn/pristine/9f/9f4beabd38280c7a09abbb00b0d7480cdad5b994.svn-base b/jni/pjproject-android/.svn/pristine/9f/9f4beabd38280c7a09abbb00b0d7480cdad5b994.svn-base
new file mode 100644
index 0000000..8489894
--- /dev/null
+++ b/jni/pjproject-android/.svn/pristine/9f/9f4beabd38280c7a09abbb00b0d7480cdad5b994.svn-base
@@ -0,0 +1,3732 @@
+<?xml version="1.0" encoding="Windows-1252"?>
+<VisualStudioProject
+ ProjectType="Visual C++"
+ Version="8.00"
+ Name="pjmedia_codec"
+ ProjectGUID="{855DC8C0-D3E9-4A2E-AE47-116605A7BC9B}"
+ RootNamespace="pjmedia_codec"
+ >
+ <Platforms>
+ <Platform
+ Name="Win32"
+ />
+ <Platform
+ Name="Pocket PC 2003 (ARMV4)"
+ />
+ <Platform
+ Name="Smartphone 2003 (ARMV4)"
+ />
+ <Platform
+ Name="x64"
+ />
+ <Platform
+ Name="Windows Mobile 6 Standard SDK (ARMV4I)"
+ />
+ <Platform
+ Name="Windows Mobile 6 Professional SDK (ARMV4I)"
+ />
+ <Platform
+ Name="Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ />
+ <Platform
+ Name="Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ />
+ </Platforms>
+ <ToolFiles>
+ </ToolFiles>
+ <Configurations>
+ <Configuration
+ Name="Debug|Win32"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-win32-common-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|Pocket PC 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|Smartphone 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|x64"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-win64-common-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ TargetEnvironment="3"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ DebugInformationFormat="3"
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Win32"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-win32-release-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Pocket PC 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Smartphone 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|x64"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-win64-release-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ TargetEnvironment="3"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Win32"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-win32-common-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Pocket PC 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Smartphone 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|x64"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-win64-common-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ TargetEnvironment="3"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ DebugInformationFormat="3"
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Win32"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-win32-release-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Pocket PC 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Smartphone 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|x64"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-win64-release-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ TargetEnvironment="3"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Win32"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-win32-common-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Pocket PC 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Smartphone 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|x64"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-win64-common-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ TargetEnvironment="3"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ DebugInformationFormat="3"
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Win32"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-win32-release-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Pocket PC 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Smartphone 2003 (ARMV4)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm2003-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm2003sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|x64"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-win64-release-defaults.vsprops"
+ UseOfMFC="0"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="2"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ TargetEnvironment="3"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-$(PlatformName)-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCFxCopTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|Windows Mobile 6 Standard SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6std-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|Windows Mobile 6 Professional SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6pro-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug|Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Windows Mobile 6 Standard SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6std-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Windows Mobile 6 Professional SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6pro-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release|Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Windows Mobile 6 Standard SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6std-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Windows Mobile 6 Professional SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6pro-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Static|Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Windows Mobile 6 Standard SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6std-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Windows Mobile 6 Professional SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6pro-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Dynamic|Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Windows Mobile 6 Standard SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6std-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Windows Mobile 6 Professional SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6pro-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Debug-Dynamic|Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-debug-dynamic-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-common-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Windows Mobile 6 Standard SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6std-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Windows Mobile 6 Professional SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm6-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm6pro-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Windows Mobile 5.0 Pocket PC SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5ppc-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ <Configuration
+ Name="Release-Static|Windows Mobile 5.0 Smartphone SDK (ARMV4I)"
+ ConfigurationType="4"
+ InheritedPropertySheets="..\..\build\vs\pjproject-vs8-release-static-defaults.vsprops;..\..\build\vs\pjproject-vs8-wm5-release-defaults.vsprops"
+ ATLMinimizesCRunTimeLibraryUsage="false"
+ CharacterSet="1"
+ >
+ <Tool
+ Name="VCPreBuildEventTool"
+ />
+ <Tool
+ Name="VCCustomBuildTool"
+ />
+ <Tool
+ Name="VCXMLDataGeneratorTool"
+ />
+ <Tool
+ Name="VCWebServiceProxyGeneratorTool"
+ />
+ <Tool
+ Name="VCMIDLTool"
+ />
+ <Tool
+ Name="VCCLCompilerTool"
+ ExecutionBucket="7"
+ AdditionalIncludeDirectories="../include;../../pjlib/include;../../third_party/speex/include;../../third_party"
+ PreprocessorDefinitions="_LIB;"
+ PrecompiledHeaderFile=""
+ />
+ <Tool
+ Name="VCManagedResourceCompilerTool"
+ />
+ <Tool
+ Name="VCResourceCompilerTool"
+ />
+ <Tool
+ Name="VCPreLinkEventTool"
+ />
+ <Tool
+ Name="VCLibrarianTool"
+ OutputFile="..\lib\pjmedia-codec-$(TargetCPU)-wm5sp-vc$(VSVer)-$(ConfigurationName).lib"
+ />
+ <Tool
+ Name="VCALinkTool"
+ />
+ <Tool
+ Name="VCXDCMakeTool"
+ />
+ <Tool
+ Name="VCBscMakeTool"
+ />
+ <Tool
+ Name="VCCodeSignTool"
+ />
+ <Tool
+ Name="VCPostBuildEventTool"
+ />
+ <DeploymentTool
+ ForceDirty="-1"
+ RemoteDirectory=""
+ RegisterOutput="0"
+ AdditionalFiles=""
+ />
+ <DebuggerTool
+ />
+ </Configuration>
+ </Configurations>
+ <References>
+ </References>
+ <Files>
+ <Filter
+ Name="Source Files"
+ Filter="cpp;c;cxx;rc;def;r;odl;idl;hpj;bat"
+ >
+ <File
+ RelativePath="..\src\pjmedia-codec\amr_sdp_match.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\audio_codecs.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\ffmpeg_vid_codecs.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\g722.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\g7221.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\g7221_sdp_match.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\gsm.c"
+ >
+ <FileConfiguration
+ Name="Debug|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\h263_packetizer.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\h264_packetizer.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\ilbc.c"
+ >
+ <FileConfiguration
+ Name="Debug|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\ipp_codecs.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\l16.c"
+ >
+ <FileConfiguration
+ Name="Debug|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\opencore_amr.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\passthrough.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\silk.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\speex_codec.c"
+ >
+ <FileConfiguration
+ Name="Debug|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Debug-Dynamic|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|Win32"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ <FileConfiguration
+ Name="Release-Static|x64"
+ >
+ <Tool
+ Name="VCCLCompilerTool"
+ AdditionalIncludeDirectories=""
+ PreprocessorDefinitions=""
+ />
+ </FileConfiguration>
+ </File>
+ <Filter
+ Name="g722 Files"
+ >
+ <File
+ RelativePath="..\src\pjmedia-codec\g722\g722_dec.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\g722\g722_dec.h"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\g722\g722_enc.c"
+ >
+ </File>
+ <File
+ RelativePath="..\src\pjmedia-codec\g722\g722_enc.h"
+ >
+ </File>
+ </Filter>
+ </Filter>
+ <Filter
+ Name="Header Files"
+ Filter="h;hpp;hxx;hm;inl"
+ >
+ <File
+ RelativePath="..\include\pjmedia-codec\amr_helper.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\amr_sdp_match.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\audio_codecs.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\config.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\ffmpeg_vid_codecs.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\g722.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\g7221.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\g7221_sdp_match.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\gsm.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\h263_packetizer.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\h264_packetizer.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\ilbc.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\ipp_codecs.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\l16.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\opencore_amr.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\passthrough.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\silk.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\speex.h"
+ >
+ </File>
+ <File
+ RelativePath="..\include\pjmedia-codec\types.h"
+ >
+ </File>
+ </Filter>
+ </Files>
+ <Globals>
+ </Globals>
+</VisualStudioProject>
diff --git a/jni/pjproject-android/.svn/pristine/9f/9f5122850959e8bc3c655897638890118de412c7.svn-base b/jni/pjproject-android/.svn/pristine/9f/9f5122850959e8bc3c655897638890118de412c7.svn-base
new file mode 100644
index 0000000..b30f6d3
--- /dev/null
+++ b/jni/pjproject-android/.svn/pristine/9f/9f5122850959e8bc3c655897638890118de412c7.svn-base
@@ -0,0 +1,1913 @@
+/*
+ * srtp.c
+ *
+ * the secure real-time transport protocol
+ *
+ * David A. McGrew
+ * Cisco Systems, Inc.
+ */
+/*
+ *
+ * Copyright (c) 2001-2006, Cisco Systems, Inc.
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions
+ * are met:
+ *
+ * Redistributions of source code must retain the above copyright
+ * notice, this list of conditions and the following disclaimer.
+ *
+ * Redistributions in binary form must reproduce the above
+ * copyright notice, this list of conditions and the following
+ * disclaimer in the documentation and/or other materials provided
+ * with the distribution.
+ *
+ * Neither the name of the Cisco Systems, Inc. nor the names of its
+ * contributors may be used to endorse or promote products derived
+ * from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
+ * FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT HOLDERS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT,
+ * INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+ * (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+ * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION)
+ * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT,
+ * STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+ * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+
+#include "srtp_priv.h"
+#include "aes_icm.h" /* aes_icm is used in the KDF */
+#include "alloc.h" /* for crypto_alloc() */
+
+#ifndef SRTP_KERNEL
+# include <limits.h>
+# ifdef HAVE_NETINET_IN_H
+# include <netinet/in.h>
+# elif defined(HAVE_WINSOCK2_H)
+# include <winsock2.h>
+# endif
+#endif /* ! SRTP_KERNEL */
+
+
+extern cipher_type_t aes_icm;
+extern auth_type_t tmmhv2;
+
+/* the debug module for srtp */
+
+debug_module_t mod_srtp = {
+ 0, /* debugging is off by default */
+ "srtp" /* printable name for module */
+};
+
+#define octets_in_rtp_header 12
+#define uint32s_in_rtp_header 3
+#define octets_in_rtcp_header 8
+#define uint32s_in_rtcp_header 2
+
+
+err_status_t
+srtp_stream_alloc(srtp_stream_ctx_t **str_ptr,
+ const srtp_policy_t *p) {
+ srtp_stream_ctx_t *str;
+ err_status_t stat;
+
+ /*
+ * This function allocates the stream context, rtp and rtcp ciphers
+ * and auth functions, and key limit structure. If there is a
+ * failure during allocation, we free all previously allocated
+ * memory and return a failure code. The code could probably
+ * be improved, but it works and should be clear.
+ */
+
+ /* allocate srtp stream and set str_ptr */
+ str = (srtp_stream_ctx_t *) crypto_alloc(sizeof(srtp_stream_ctx_t));
+ if (str == NULL)
+ return err_status_alloc_fail;
+ *str_ptr = str;
+
+ /* allocate cipher */
+ stat = crypto_kernel_alloc_cipher(p->rtp.cipher_type,
+ &str->rtp_cipher,
+ p->rtp.cipher_key_len);
+ if (stat) {
+ crypto_free(str);
+ return stat;
+ }
+
+ /* allocate auth function */
+ stat = crypto_kernel_alloc_auth(p->rtp.auth_type,
+ &str->rtp_auth,
+ p->rtp.auth_key_len,
+ p->rtp.auth_tag_len);
+ if (stat) {
+ cipher_dealloc(str->rtp_cipher);
+ crypto_free(str);
+ return stat;
+ }
+
+ /* allocate key limit structure */
+ str->limit = (key_limit_ctx_t*) crypto_alloc(sizeof(key_limit_ctx_t));
+ if (str->limit == NULL) {
+ auth_dealloc(str->rtp_auth);
+ cipher_dealloc(str->rtp_cipher);
+ crypto_free(str);
+ return err_status_alloc_fail;
+ }
+
+ /*
+ * ...and now the RTCP-specific initialization - first, allocate
+ * the cipher
+ */
+ stat = crypto_kernel_alloc_cipher(p->rtcp.cipher_type,
+ &str->rtcp_cipher,
+ p->rtcp.cipher_key_len);
+ if (stat) {
+ auth_dealloc(str->rtp_auth);
+ cipher_dealloc(str->rtp_cipher);
+ crypto_free(str->limit);
+ crypto_free(str);
+ return stat;
+ }
+
+ /* allocate auth function */
+ stat = crypto_kernel_alloc_auth(p->rtcp.auth_type,
+ &str->rtcp_auth,
+ p->rtcp.auth_key_len,
+ p->rtcp.auth_tag_len);
+ if (stat) {
+ cipher_dealloc(str->rtcp_cipher);
+ auth_dealloc(str->rtp_auth);
+ cipher_dealloc(str->rtp_cipher);
+ crypto_free(str->limit);
+ crypto_free(str);
+ return stat;
+ }
+
+ return err_status_ok;
+}
+
+err_status_t
+srtp_stream_dealloc(srtp_t session, srtp_stream_ctx_t *stream) {
+ err_status_t status;
+
+ /*
+ * we use a conservative deallocation strategy - if any deallocation
+ * fails, then we report that fact without trying to deallocate
+ * anything else
+ */
+
+ /* deallocate cipher, if it is not the same as that in template */
+ if (session->stream_template
+ && stream->rtp_cipher == session->stream_template->rtp_cipher) {
+ /* do nothing */
+ } else {
+ status = cipher_dealloc(stream->rtp_cipher);
+ if (status)
+ return status;
+ }
+
+ /* deallocate auth function, if it is not the same as that in template */
+ if (session->stream_template
+ && stream->rtp_auth == session->stream_template->rtp_auth) {
+ /* do nothing */
+ } else {
+ status = auth_dealloc(stream->rtp_auth);
+ if (status)
+ return status;
+ }
+
+ /* deallocate key usage limit, if it is not the same as that in template */
+ if (session->stream_template
+ && stream->limit == session->stream_template->limit) {
+ /* do nothing */
+ } else {
+ crypto_free(stream->limit);
+ }
+
+ /*
+ * deallocate rtcp cipher, if it is not the same as that in
+ * template
+ */
+ if (session->stream_template
+ && stream->rtcp_cipher == session->stream_template->rtcp_cipher) {
+ /* do nothing */
+ } else {
+ status = cipher_dealloc(stream->rtcp_cipher);
+ if (status)
+ return status;
+ }
+
+ /*
+ * deallocate rtcp auth function, if it is not the same as that in
+ * template
+ */
+ if (session->stream_template
+ && stream->rtcp_auth == session->stream_template->rtcp_auth) {
+ /* do nothing */
+ } else {
+ status = auth_dealloc(stream->rtcp_auth);
+ if (status)
+ return status;
+ }
+
+ /* deallocate srtp stream context */
+ crypto_free(stream);
+
+ return err_status_ok;
+}
+
+
+/*
+ * srtp_stream_clone(stream_template, new) allocates a new stream and
+ * initializes it using the cipher and auth of the stream_template
+ *
+ * the only unique data in a cloned stream is the replay database and
+ * the SSRC
+ */
+
+err_status_t
+srtp_stream_clone(const srtp_stream_ctx_t *stream_template,
+ uint32_t ssrc,
+ srtp_stream_ctx_t **str_ptr) {
+ err_status_t status;
+ srtp_stream_ctx_t *str;
+
+ debug_print(mod_srtp, "cloning stream (SSRC: 0x%08x)", ssrc);
+
+ /* allocate srtp stream and set str_ptr */
+ str = (srtp_stream_ctx_t *) crypto_alloc(sizeof(srtp_stream_ctx_t));
+ if (str == NULL)
+ return err_status_alloc_fail;
+ *str_ptr = str;
+
+ /* set cipher and auth pointers to those of the template */
+ str->rtp_cipher = stream_template->rtp_cipher;
+ str->rtp_auth = stream_template->rtp_auth;
+ str->rtcp_cipher = stream_template->rtcp_cipher;
+ str->rtcp_auth = stream_template->rtcp_auth;
+
+ /* set key limit to point to that of the template */
+ status = key_limit_clone(stream_template->limit, &str->limit);
+ if (status)
+ return status;
+
+ /* initialize replay databases */
+ rdbx_init(&str->rtp_rdbx);
+ rdb_init(&str->rtcp_rdb);
+
+ /* set ssrc to that provided */
+ str->ssrc = ssrc;
+
+ /* set direction and security services */
+ str->direction = stream_template->direction;
+ str->rtp_services = stream_template->rtp_services;
+ str->rtcp_services = stream_template->rtcp_services;
+
+ /* defensive coding */
+ str->next = NULL;
+
+ return err_status_ok;
+}
+
+
+/*
+ * key derivation functions, internal to libSRTP
+ *
+ * srtp_kdf_t is a key derivation context
+ *
+ * srtp_kdf_init(&kdf, k) initializes kdf with the key k
+ *
+ * srtp_kdf_generate(&kdf, l, kl, keylen) derives the key
+ * corresponding to label l and puts it into kl; the length
+ * of the key in octets is provided as keylen. this function
+ * should be called once for each subkey that is derived.
+ *
+ * srtp_kdf_clear(&kdf) zeroizes the kdf state
+ */
+
+typedef enum {
+ label_rtp_encryption = 0x00,
+ label_rtp_msg_auth = 0x01,
+ label_rtp_salt = 0x02,
+ label_rtcp_encryption = 0x03,
+ label_rtcp_msg_auth = 0x04,
+ label_rtcp_salt = 0x05
+} srtp_prf_label;
+
+
+/*
+ * srtp_kdf_t represents a key derivation function. The SRTP
+ * default KDF is the only one implemented at present.
+ */
+
+typedef struct {
+ aes_icm_ctx_t c; /* cipher used for key derivation */
+} srtp_kdf_t;
+
+err_status_t
+srtp_kdf_init(srtp_kdf_t *kdf, const uint8_t key[30]) {
+
+ aes_icm_context_init(&kdf->c, key);
+
+ return err_status_ok;
+}
+
+err_status_t
+srtp_kdf_generate(srtp_kdf_t *kdf, srtp_prf_label label,
+ uint8_t *key, int length) {
+
+ v128_t nonce;
+
+ /* set eigth octet of nonce to <label>, set the rest of it to zero */
+ v128_set_to_zero(&nonce);
+ nonce.v8[7] = label;
+
+ aes_icm_set_iv(&kdf->c, &nonce);
+
+ /* generate keystream output */
+ aes_icm_output(&kdf->c, key, length);
+
+ return err_status_ok;
+}
+
+err_status_t
+srtp_kdf_clear(srtp_kdf_t *kdf) {
+
+ /* zeroize aes context */
+ octet_string_set_to_zero((uint8_t *)kdf, sizeof(srtp_kdf_t));
+
+ return err_status_ok;
+}
+
+/*
+ * end of key derivation functions
+ */
+
+#define MAX_SRTP_KEY_LEN 256
+
+
+err_status_t
+srtp_stream_init_keys(srtp_stream_ctx_t *srtp, const void *key) {
+ err_status_t stat;
+ srtp_kdf_t kdf;
+ uint8_t tmp_key[MAX_SRTP_KEY_LEN];
+
+ /* initialize KDF state */
+ srtp_kdf_init(&kdf, (const uint8_t *)key);
+
+ /* generate encryption key */
+ srtp_kdf_generate(&kdf, label_rtp_encryption,
+ tmp_key, cipher_get_key_length(srtp->rtp_cipher));
+ /*
+ * if the cipher in the srtp context is aes_icm, then we need
+ * to generate the salt value
+ */
+ if (srtp->rtp_cipher->type == &aes_icm) {
+ /* FIX!!! this is really the cipher key length; rest is salt */
+ int base_key_len = 16;
+ int salt_len = cipher_get_key_length(srtp->rtp_cipher) - base_key_len;
+
+ debug_print(mod_srtp, "found aes_icm, generating salt", NULL);
+
+ /* generate encryption salt, put after encryption key */
+ srtp_kdf_generate(&kdf, label_rtp_salt,
+ tmp_key + base_key_len, salt_len);
+ }
+ debug_print(mod_srtp, "cipher key: %s",
+ octet_string_hex_string(tmp_key,
+ cipher_get_key_length(srtp->rtp_cipher)));
+
+ /* initialize cipher */
+ stat = cipher_init(srtp->rtp_cipher, tmp_key, direction_any);
+ if (stat) {
+ /* zeroize temp buffer */
+ octet_string_set_to_zero(tmp_key, MAX_SRTP_KEY_LEN);
+ return err_status_init_fail;
+ }
+
+ /* generate authentication key */
+ srtp_kdf_generate(&kdf, label_rtp_msg_auth,
+ tmp_key, auth_get_key_length(srtp->rtp_auth));
+ debug_print(mod_srtp, "auth key: %s",
+ octet_string_hex_string(tmp_key,
+ auth_get_key_length(srtp->rtp_auth)));
+
+ /* initialize auth function */
+ stat = auth_init(srtp->rtp_auth, tmp_key);
+ if (stat) {
+ /* zeroize temp buffer */
+ octet_string_set_to_zero(tmp_key, MAX_SRTP_KEY_LEN);
+ return err_status_init_fail;
+ }
+
+ /*
+ * ...now initialize SRTCP keys
+ */
+
+ /* generate encryption key */
+ srtp_kdf_generate(&kdf, label_rtcp_encryption,
+ tmp_key, cipher_get_key_length(srtp->rtcp_cipher));
+ /*
+ * if the cipher in the srtp context is aes_icm, then we need
+ * to generate the salt value
+ */
+ if (srtp->rtcp_cipher->type == &aes_icm) {
+ /* FIX!!! this is really the cipher key length; rest is salt */
+ int base_key_len = 16;
+ int salt_len = cipher_get_key_length(srtp->rtcp_cipher) - base_key_len;
+
+ debug_print(mod_srtp, "found aes_icm, generating rtcp salt", NULL);
+
+ /* generate encryption salt, put after encryption key */
+ srtp_kdf_generate(&kdf, label_rtcp_salt,
+ tmp_key + base_key_len, salt_len);
+ }
+ debug_print(mod_srtp, "rtcp cipher key: %s",
+ octet_string_hex_string(tmp_key,
+ cipher_get_key_length(srtp->rtcp_cipher)));
+
+ /* initialize cipher */
+ stat = cipher_init(srtp->rtcp_cipher, tmp_key, direction_any);
+ if (stat) {
+ /* zeroize temp buffer */
+ octet_string_set_to_zero(tmp_key, MAX_SRTP_KEY_LEN);
+ return err_status_init_fail;
+ }
+
+ /* generate authentication key */
+ srtp_kdf_generate(&kdf, label_rtcp_msg_auth,
+ tmp_key, auth_get_key_length(srtp->rtcp_auth));
+ debug_print(mod_srtp, "rtcp auth key: %s",
+ octet_string_hex_string(tmp_key,
+ auth_get_key_length(srtp->rtcp_auth)));
+
+ /* initialize auth function */
+ stat = auth_init(srtp->rtcp_auth, tmp_key);
+ if (stat) {
+ /* zeroize temp buffer */
+ octet_string_set_to_zero(tmp_key, MAX_SRTP_KEY_LEN);
+ return err_status_init_fail;
+ }
+
+ /* clear memory then return */
+ srtp_kdf_clear(&kdf);
+ octet_string_set_to_zero(tmp_key, MAX_SRTP_KEY_LEN);
+
+ return err_status_ok;
+}
+
+err_status_t
+srtp_stream_init(srtp_stream_ctx_t *srtp,
+ const srtp_policy_t *p) {
+ err_status_t err;
+
+ debug_print(mod_srtp, "initializing stream (SSRC: 0x%08x)",
+ p->ssrc.value);
+
+ /* initialize replay database */
+ rdbx_init(&srtp->rtp_rdbx);
+
+ /* initialize key limit to maximum value */
+#ifdef NO_64BIT_MATH
+{
+ uint64_t temp;
+ temp = make64(UINT_MAX,UINT_MAX);
+ key_limit_set(srtp->limit, temp);
+}
+#else
+ key_limit_set(srtp->limit, PJ_UINT64(0xffffffffffff));
+#endif
+
+ /* set the SSRC value */
+ srtp->ssrc = htonl(p->ssrc.value);
+
+ /* set the security service flags */
+ srtp->rtp_services = p->rtp.sec_serv;
+ srtp->rtcp_services = p->rtcp.sec_serv;
+
+ /*
+ * set direction to unknown - this flag gets checked in srtp_protect(),
+ * srtp_unprotect(), srtp_protect_rtcp(), and srtp_unprotect_rtcp(), and
+ * gets set appropriately if it is set to unknown.
+ */
+ srtp->direction = dir_unknown;
+
+ /* initialize SRTCP replay database */
+ rdb_init(&srtp->rtcp_rdb);
+
+ /* DAM - no RTCP key limit at present */
+
+ /* initialize keys */
+ err = srtp_stream_init_keys(srtp, p->key);
+ if (err) return err;
+
+ return err_status_ok;
+ }
+
+
+ /*
+ * srtp_event_reporter is an event handler function that merely
+ * reports the events that are reported by the callbacks
+ */
+
+ void
+ srtp_event_reporter(srtp_event_data_t *data) {
+
+ err_report(err_level_warning, "srtp: in stream 0x%x: ",
+ data->stream->ssrc);
+
+ switch(data->event) {
+ case event_ssrc_collision:
+ err_report(err_level_warning, "\tSSRC collision\n");
+ break;
+ case event_key_soft_limit:
+ err_report(err_level_warning, "\tkey usage soft limit reached\n");
+ break;
+ case event_key_hard_limit:
+ err_report(err_level_warning, "\tkey usage hard limit reached\n");
+ break;
+ case event_packet_index_limit:
+ err_report(err_level_warning, "\tpacket index limit reached\n");
+ break;
+ default:
+ err_report(err_level_warning, "\tunknown event reported to handler\n");
+ }
+ }
+
+ /*
+ * srtp_event_handler is a global variable holding a pointer to the
+ * event handler function; this function is called for any unexpected
+ * event that needs to be handled out of the SRTP data path. see
+ * srtp_event_t in srtp.h for more info
+ *
+ * it is okay to set srtp_event_handler to NULL, but we set
+ * it to the srtp_event_reporter.
+ */
+
+ static srtp_event_handler_func_t *srtp_event_handler = srtp_event_reporter;
+
+ err_status_t
+ srtp_install_event_handler(srtp_event_handler_func_t func) {
+
+ /*
+ * note that we accept NULL arguments intentionally - calling this
+ * function with a NULL arguments removes an event handler that's
+ * been previously installed
+ */
+
+ /* set global event handling function */
+ srtp_event_handler = func;
+ return err_status_ok;
+ }
+
+ err_status_t
+ srtp_protect(srtp_ctx_t *ctx, void *rtp_hdr, int *pkt_octet_len) {
+ srtp_hdr_t *hdr = (srtp_hdr_t *)rtp_hdr;
+ uint32_t *enc_start; /* pointer to start of encrypted portion */
+ uint32_t *auth_start; /* pointer to start of auth. portion */
+ unsigned enc_octet_len = 0; /* number of octets in encrypted portion */
+ xtd_seq_num_t est; /* estimated xtd_seq_num_t of *hdr */
+ int delta; /* delta of local pkt idx and that in hdr */
+ uint8_t *auth_tag = NULL; /* location of auth_tag within packet */
+ err_status_t status;
+ int tag_len;
+ srtp_stream_ctx_t *stream;
+ int prefix_len;
+
+ debug_print(mod_srtp, "function srtp_protect", NULL);
+
+ /* we assume the hdr is 32-bit aligned to start */
+
+ /* check the packet length - it must at least contain a full header */
+ if (*pkt_octet_len < octets_in_rtp_header)
+ return err_status_bad_param;
+
+ /*
+ * look up ssrc in srtp_stream list, and process the packet with
+ * the appropriate stream. if we haven't seen this stream before,
+ * there's a template key for this srtp_session, and the cipher
+ * supports key-sharing, then we assume that a new stream using
+ * that key has just started up
+ */
+ stream = srtp_get_stream(ctx, hdr->ssrc);
+ if (stream == NULL) {
+ if (ctx->stream_template != NULL) {
+ srtp_stream_ctx_t *new_stream;
+
+ /* allocate and initialize a new stream */
+ status = srtp_stream_clone(ctx->stream_template,
+ hdr->ssrc, &new_stream);
+ if (status)
+ return status;
+
+ /* add new stream to the head of the stream_list */
+ new_stream->next = ctx->stream_list;
+ ctx->stream_list = new_stream;
+
+ /* set direction to outbound */
+ new_stream->direction = dir_srtp_sender;
+
+ /* set stream (the pointer used in this function) */
+ stream = new_stream;
+ } else {
+ /* no template stream, so we return an error */
+ return err_status_no_ctx;
+ }
+ }
+
+ /*
+ * verify that stream is for sending traffic - this check will
+ * detect SSRC collisions, since a stream that appears in both
+ * srtp_protect() and srtp_unprotect() will fail this test in one of
+ * those functions.
+ */
+ if (stream->direction != dir_srtp_sender) {
+ if (stream->direction == dir_unknown) {
+ stream->direction = dir_srtp_sender;
+ } else {
+ srtp_handle_event(ctx, stream, event_ssrc_collision);
+ }
+ }
+
+ /*
+ * update the key usage limit, and check it to make sure that we
+ * didn't just hit either the soft limit or the hard limit, and call
+ * the event handler if we hit either.
+ */
+ switch(key_limit_update(stream->limit)) {
+ case key_event_normal:
+ break;
+ case key_event_soft_limit:
+ srtp_handle_event(ctx, stream, event_key_soft_limit);
+ break;
+ case key_event_hard_limit:
+ srtp_handle_event(ctx, stream, event_key_hard_limit);
+ return err_status_key_expired;
+ default:
+ break;
+ }
+
+ /* get tag length from stream */
+ tag_len = auth_get_tag_length(stream->rtp_auth);
+
+ /*
+ * find starting point for encryption and length of data to be
+ * encrypted - the encrypted portion starts after the rtp header
+ * extension, if present; otherwise, it starts after the last csrc,
+ * if any are present
+ *
+ * if we're not providing confidentiality, set enc_start to NULL
+ */
+ if (stream->rtp_services & sec_serv_conf) {
+ enc_start = (uint32_t *)hdr + uint32s_in_rtp_header + hdr->cc;
+ if (hdr->x == 1) {
+ srtp_hdr_xtnd_t *xtn_hdr = (srtp_hdr_xtnd_t *)enc_start;
+ enc_start += (ntohs(xtn_hdr->length) + 1);
+ }
+ enc_octet_len = (unsigned int)(*pkt_octet_len
+ - ((enc_start - (uint32_t *)hdr) << 2));
+ } else {
+ enc_start = NULL;
+ }
+
+ /*
+ * if we're providing authentication, set the auth_start and auth_tag
+ * pointers to the proper locations; otherwise, set auth_start to NULL
+ * to indicate that no authentication is needed
+ */
+ if (stream->rtp_services & sec_serv_auth) {
+ auth_start = (uint32_t *)hdr;
+ auth_tag = (uint8_t *)hdr + *pkt_octet_len;
+ } else {
+ auth_start = NULL;
+ auth_tag = NULL;
+ }
+
+ /*
+ * estimate the packet index using the start of the replay window
+ * and the sequence number from the header
+ */
+ delta = rdbx_estimate_index(&stream->rtp_rdbx, &est, ntohs(hdr->seq));
+ status = rdbx_check(&stream->rtp_rdbx, delta);
+ if (status)
+ return status; /* we've been asked to reuse an index */
+ rdbx_add_index(&stream->rtp_rdbx, delta);
+
+#ifdef NO_64BIT_MATH
+ debug_print2(mod_srtp, "estimated packet index: %08x%08x",
+ high32(est),low32(est));
+#else
+ debug_print(mod_srtp, "estimated packet index: %016llx", est);
+#endif
+
+ /*
+ * if we're using rindael counter mode, set nonce and seq
+ */
+ if (stream->rtp_cipher->type == &aes_icm) {
+ v128_t iv;
+
+ iv.v32[0] = 0;
+ iv.v32[1] = hdr->ssrc;
+#ifdef NO_64BIT_MATH
+ iv.v64[1] = be64_to_cpu(make64((high32(est) << 16) | (low32(est) >> 16),
+ low32(est) << 16));
+#else
+ iv.v64[1] = be64_to_cpu(est << 16);
+#endif
+ status = cipher_set_iv(stream->rtp_cipher, &iv);
+
+ } else {
+ v128_t iv;
+
+ /* otherwise, set the index to est */
+#ifdef NO_64BIT_MATH
+ iv.v32[0] = 0;
+ iv.v32[1] = 0;
+#else
+ iv.v64[0] = 0;
+#endif
+ iv.v64[1] = be64_to_cpu(est);
+ status = cipher_set_iv(stream->rtp_cipher, &iv);
+ }
+ if (status)
+ return err_status_cipher_fail;
+
+ /* shift est, put into network byte order */
+#ifdef NO_64BIT_MATH
+ est = be64_to_cpu(make64((high32(est) << 16) |
+ (low32(est) >> 16),
+ low32(est) << 16));
+#else
+ est = be64_to_cpu(est << 16);
+#endif
+
+ /*
+ * if we're authenticating using a universal hash, put the keystream
+ * prefix into the authentication tag
+ */
+ if (auth_start) {
+
+ prefix_len = auth_get_prefix_length(stream->rtp_auth);
+ if (prefix_len) {
+ status = cipher_output(stream->rtp_cipher, auth_tag, prefix_len);
+ if (status)
+ return err_status_cipher_fail;
+ debug_print(mod_srtp, "keystream prefix: %s",
+ octet_string_hex_string(auth_tag, prefix_len));
+ }
+ }
+
+ /* if we're encrypting, exor keystream into the message */
+ if (enc_start) {
+ status = cipher_encrypt(stream->rtp_cipher,
+ (uint8_t *)enc_start, &enc_octet_len);
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /*
+ * if we're authenticating, run authentication function and put result
+ * into the auth_tag
+ */
+ if (auth_start) {
+
+ /* initialize auth func context */
+ status = auth_start(stream->rtp_auth);
+ if (status) return status;
+
+ /* run auth func over packet */
+ status = auth_update(stream->rtp_auth,
+ (uint8_t *)auth_start, *pkt_octet_len);
+ if (status) return status;
+
+ /* run auth func over ROC, put result into auth_tag */
+ debug_print(mod_srtp, "estimated packet index: %016llx", est);
+ status = auth_compute(stream->rtp_auth, (uint8_t *)&est, 4, auth_tag);
+ debug_print(mod_srtp, "srtp auth tag: %s",
+ octet_string_hex_string(auth_tag, tag_len));
+ if (status)
+ return err_status_auth_fail;
+
+ }
+
+ if (auth_tag) {
+
+ /* increase the packet length by the length of the auth tag */
+ *pkt_octet_len += tag_len;
+ }
+
+ return err_status_ok;
+}
+
+
+err_status_t
+srtp_unprotect(srtp_ctx_t *ctx, void *srtp_hdr, int *pkt_octet_len) {
+ srtp_hdr_t *hdr = (srtp_hdr_t *)srtp_hdr;
+ uint32_t *enc_start; /* pointer to start of encrypted portion */
+ uint32_t *auth_start; /* pointer to start of auth. portion */
+ unsigned enc_octet_len = 0;/* number of octets in encrypted portion */
+ uint8_t *auth_tag = NULL; /* location of auth_tag within packet */
+ xtd_seq_num_t est; /* estimated xtd_seq_num_t of *hdr */
+ int delta; /* delta of local pkt idx and that in hdr */
+ v128_t iv;
+ err_status_t status;
+ srtp_stream_ctx_t *stream;
+ uint8_t tmp_tag[SRTP_MAX_TAG_LEN];
+ int tag_len, prefix_len;
+
+ debug_print(mod_srtp, "function srtp_unprotect", NULL);
+
+ /* we assume the hdr is 32-bit aligned to start */
+
+ /* check the packet length - it must at least contain a full header */
+ if (*pkt_octet_len < octets_in_rtp_header)
+ return err_status_bad_param;
+
+ /*
+ * look up ssrc in srtp_stream list, and process the packet with
+ * the appropriate stream. if we haven't seen this stream before,
+ * there's only one key for this srtp_session, and the cipher
+ * supports key-sharing, then we assume that a new stream using
+ * that key has just started up
+ */
+ stream = srtp_get_stream(ctx, hdr->ssrc);
+ if (stream == NULL) {
+ if (ctx->stream_template != NULL) {
+ stream = ctx->stream_template;
+ debug_print(mod_srtp, "using provisional stream (SSRC: 0x%08x)",
+ hdr->ssrc);
+
+ /*
+ * set estimated packet index to sequence number from header,
+ * and set delta equal to the same value
+ */
+#ifdef NO_64BIT_MATH
+ est = (xtd_seq_num_t) make64(0,ntohs(hdr->seq));
+ delta = low32(est);
+#else
+ est = (xtd_seq_num_t) ntohs(hdr->seq);
+ delta = (int)est;
+#endif
+ } else {
+
+ /*
+ * no stream corresponding to SSRC found, and we don't do
+ * key-sharing, so return an error
+ */
+ return err_status_no_ctx;
+ }
+ } else {
+
+ /* estimate packet index from seq. num. in header */
+ delta = rdbx_estimate_index(&stream->rtp_rdbx, &est, ntohs(hdr->seq));
+
+ /* check replay database */
+ status = rdbx_check(&stream->rtp_rdbx, delta);
+ if (status)
+ return status;
+ }
+
+#ifdef NO_64BIT_MATH
+ debug_print2(mod_srtp, "estimated u_packet index: %08x%08x", high32(est),low32(est));
+#else
+ debug_print(mod_srtp, "estimated u_packet index: %016llx", est);
+#endif
+
+ /* get tag length from stream */
+ tag_len = auth_get_tag_length(stream->rtp_auth);
+
+ /*
+ * set the cipher's IV properly, depending on whatever cipher we
+ * happen to be using
+ */
+ if (stream->rtp_cipher->type == &aes_icm) {
+
+ /* aes counter mode */
+ iv.v32[0] = 0;
+ iv.v32[1] = hdr->ssrc; /* still in network order */
+#ifdef NO_64BIT_MATH
+ iv.v64[1] = be64_to_cpu(make64((high32(est) << 16) | (low32(est) >> 16),
+ low32(est) << 16));
+#else
+ iv.v64[1] = be64_to_cpu(est << 16);
+#endif
+ status = aes_icm_set_iv((aes_icm_ctx_t*)stream->rtp_cipher->state, &iv);
+ } else {
+
+ /* no particular format - set the iv to the pakcet index */
+#ifdef NO_64BIT_MATH
+ iv.v32[0] = 0;
+ iv.v32[1] = 0;
+#else
+ iv.v64[0] = 0;
+#endif
+ iv.v64[1] = be64_to_cpu(est);
+ status = cipher_set_iv(stream->rtp_cipher, &iv);
+ }
+ if (status)
+ return err_status_cipher_fail;
+
+ /* shift est, put into network byte order */
+#ifdef NO_64BIT_MATH
+ est = be64_to_cpu(make64((high32(est) << 16) |
+ (low32(est) >> 16),
+ low32(est) << 16));
+#else
+ est = be64_to_cpu(est << 16);
+#endif
+
+ /*
+ * find starting point for decryption and length of data to be
+ * decrypted - the encrypted portion starts after the rtp header
+ * extension, if present; otherwise, it starts after the last csrc,
+ * if any are present
+ *
+ * if we're not providing confidentiality, set enc_start to NULL
+ */
+ if (stream->rtp_services & sec_serv_conf) {
+ enc_start = (uint32_t *)hdr + uint32s_in_rtp_header + hdr->cc;
+ if (hdr->x == 1) {
+ srtp_hdr_xtnd_t *xtn_hdr = (srtp_hdr_xtnd_t *)enc_start;
+ enc_start += (ntohs(xtn_hdr->length) + 1);
+ }
+ enc_octet_len = (uint32_t)(*pkt_octet_len - tag_len
+ - ((enc_start - (uint32_t *)hdr) << 2));
+ } else {
+ enc_start = NULL;
+ }
+
+ /*
+ * if we're providing authentication, set the auth_start and auth_tag
+ * pointers to the proper locations; otherwise, set auth_start to NULL
+ * to indicate that no authentication is needed
+ */
+ if (stream->rtp_services & sec_serv_auth) {
+ auth_start = (uint32_t *)hdr;
+ auth_tag = (uint8_t *)hdr + *pkt_octet_len - tag_len;
+ } else {
+ auth_start = NULL;
+ auth_tag = NULL;
+ }
+
+ /*
+ * if we expect message authentication, run the authentication
+ * function and compare the result with the value of the auth_tag
+ */
+ if (auth_start) {
+
+ /*
+ * if we're using a universal hash, then we need to compute the
+ * keystream prefix for encrypting the universal hash output
+ *
+ * if the keystream prefix length is zero, then we know that
+ * the authenticator isn't using a universal hash function
+ */
+ if (stream->rtp_auth->prefix_len != 0) {
+
+ prefix_len = auth_get_prefix_length(stream->rtp_auth);
+ status = cipher_output(stream->rtp_cipher, tmp_tag, prefix_len);
+ debug_print(mod_srtp, "keystream prefix: %s",
+ octet_string_hex_string(tmp_tag, prefix_len));
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /* initialize auth func context */
+ status = auth_start(stream->rtp_auth);
+ if (status) return status;
+
+ /* now compute auth function over packet */
+ status = auth_update(stream->rtp_auth, (uint8_t *)auth_start,
+ *pkt_octet_len - tag_len);
+
+ /* run auth func over ROC, then write tmp tag */
+ status = auth_compute(stream->rtp_auth, (uint8_t *)&est, 4, tmp_tag);
+
+ debug_print(mod_srtp, "computed auth tag: %s",
+ octet_string_hex_string(tmp_tag, tag_len));
+ debug_print(mod_srtp, "packet auth tag: %s",
+ octet_string_hex_string(auth_tag, tag_len));
+ if (status)
+ return err_status_auth_fail;
+
+ if (octet_string_is_eq(tmp_tag, auth_tag, tag_len))
+ return err_status_auth_fail;
+ }
+
+ /*
+ * update the key usage limit, and check it to make sure that we
+ * didn't just hit either the soft limit or the hard limit, and call
+ * the event handler if we hit either.
+ */
+ switch(key_limit_update(stream->limit)) {
+ case key_event_normal:
+ break;
+ case key_event_soft_limit:
+ srtp_handle_event(ctx, stream, event_key_soft_limit);
+ break;
+ case key_event_hard_limit:
+ srtp_handle_event(ctx, stream, event_key_hard_limit);
+ return err_status_key_expired;
+ default:
+ break;
+ }
+
+ /* if we're encrypting, add keystream into ciphertext */
+ if (enc_start) {
+ status = cipher_encrypt(stream->rtp_cipher,
+ (uint8_t *)enc_start, &enc_octet_len);
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /*
+ * verify that stream is for received traffic - this check will
+ * detect SSRC collisions, since a stream that appears in both
+ * srtp_protect() and srtp_unprotect() will fail this test in one of
+ * those functions.
+ *
+ * we do this check *after* the authentication check, so that the
+ * latter check will catch any attempts to fool us into thinking
+ * that we've got a collision
+ */
+ if (stream->direction != dir_srtp_receiver) {
+ if (stream->direction == dir_unknown) {
+ stream->direction = dir_srtp_receiver;
+ } else {
+ srtp_handle_event(ctx, stream, event_ssrc_collision);
+ }
+ }
+
+ /*
+ * if the stream is a 'provisional' one, in which the template context
+ * is used, then we need to allocate a new stream at this point, since
+ * the authentication passed
+ */
+ if (stream == ctx->stream_template) {
+ srtp_stream_ctx_t *new_stream;
+
+ /*
+ * allocate and initialize a new stream
+ *
+ * note that we indicate failure if we can't allocate the new
+ * stream, and some implementations will want to not return
+ * failure here
+ */
+ status = srtp_stream_clone(ctx->stream_template, hdr->ssrc, &new_stream);
+ if (status)
+ return status;
+
+ /* add new stream to the head of the stream_list */
+ new_stream->next = ctx->stream_list;
+ ctx->stream_list = new_stream;
+
+ /* set stream (the pointer used in this function) */
+ stream = new_stream;
+ }
+
+ /*
+ * the message authentication function passed, so add the packet
+ * index into the replay database
+ */
+ rdbx_add_index(&stream->rtp_rdbx, delta);
+
+ /* decrease the packet length by the length of the auth tag */
+ *pkt_octet_len -= tag_len;
+
+ return err_status_ok;
+}
+
+err_status_t
+srtp_init() {
+ err_status_t status;
+
+ /* initialize crypto kernel */
+ status = crypto_kernel_init();
+ if (status)
+ return status;
+
+ /* load srtp debug module into the kernel */
+ status = crypto_kernel_load_debug_module(&mod_srtp);
+ if (status)
+ return status;
+
+ return err_status_ok;
+}
+
+err_status_t
+srtp_deinit() {
+ err_status_t status;
+
+ status = crypto_kernel_shutdown();
+
+ return status;
+}
+
+/*
+ * The following code is under consideration for removal. See
+ * SRTP_MAX_TRAILER_LEN
+ */
+#if 0
+
+/*
+ * srtp_get_trailer_length(&a) returns the number of octets that will
+ * be added to an RTP packet by the SRTP processing. This value
+ * is constant for a given srtp_stream_t (i.e. between initializations).
+ */
+
+int
+srtp_get_trailer_length(const srtp_stream_t s) {
+ return auth_get_tag_length(s->rtp_auth);
+}
+
+#endif
+
+/*
+ * srtp_get_stream(ssrc) returns a pointer to the stream corresponding
+ * to ssrc, or NULL if no stream exists for that ssrc
+ *
+ * this is an internal function
+ */
+
+srtp_stream_ctx_t *
+srtp_get_stream(srtp_t srtp, uint32_t ssrc) {
+ srtp_stream_ctx_t *stream;
+
+ /* walk down list until ssrc is found */
+ stream = srtp->stream_list;
+ while (stream != NULL) {
+ if (stream->ssrc == ssrc)
+ return stream;
+ stream = stream->next;
+ }
+
+ /* we haven't found our ssrc, so return a null */
+ return NULL;
+}
+
+err_status_t
+srtp_dealloc(srtp_t session) {
+ srtp_stream_ctx_t *stream;
+ err_status_t status;
+
+ /*
+ * we take a conservative deallocation strategy - if we encounter an
+ * error deallocating a stream, then we stop trying to deallocate
+ * memory and just return an error
+ */
+
+ /* walk list of streams, deallocating as we go */
+ stream = session->stream_list;
+ while (stream != NULL) {
+ srtp_stream_t next = stream->next;
+ status = srtp_stream_dealloc(session, stream);
+ if (status)
+ return status;
+ stream = next;
+ }
+
+ /* deallocate stream template, if there is one */
+ if (session->stream_template != NULL) {
+ status = auth_dealloc(session->stream_template->rtcp_auth);
+ if (status)
+ return status;
+ status = cipher_dealloc(session->stream_template->rtcp_cipher);
+ if (status)
+ return status;
+ crypto_free(session->stream_template->limit);
+ status = cipher_dealloc(session->stream_template->rtp_cipher);
+ if (status)
+ return status;
+ status = auth_dealloc(session->stream_template->rtp_auth);
+ if (status)
+ return status;
+ crypto_free(session->stream_template);
+ }
+
+ /* deallocate session context */
+ crypto_free(session);
+
+ return err_status_ok;
+}
+
+
+err_status_t
+srtp_add_stream(srtp_t session,
+ const srtp_policy_t *policy) {
+ err_status_t status;
+ srtp_stream_t tmp;
+
+ /* sanity check arguments */
+ if ((session == NULL) || (policy == NULL) || (policy->key == NULL))
+ return err_status_bad_param;
+
+ /* allocate stream */
+ status = srtp_stream_alloc(&tmp, policy);
+ if (status) {
+ return status;
+ }
+
+ /* initialize stream */
+ status = srtp_stream_init(tmp, policy);
+ if (status) {
+ crypto_free(tmp);
+ return status;
+ }
+
+ /*
+ * set the head of the stream list or the template to point to the
+ * stream that we've just alloced and init'ed, depending on whether
+ * or not it has a wildcard SSRC value or not
+ *
+ * if the template stream has already been set, then the policy is
+ * inconsistent, so we return a bad_param error code
+ */
+ switch (policy->ssrc.type) {
+ case (ssrc_any_outbound):
+ if (session->stream_template) {
+ return err_status_bad_param;
+ }
+ session->stream_template = tmp;
+ session->stream_template->direction = dir_srtp_sender;
+ break;
+ case (ssrc_any_inbound):
+ if (session->stream_template) {
+ return err_status_bad_param;
+ }
+ session->stream_template = tmp;
+ session->stream_template->direction = dir_srtp_receiver;
+ break;
+ case (ssrc_specific):
+ tmp->next = session->stream_list;
+ session->stream_list = tmp;
+ break;
+ case (ssrc_undefined):
+ default:
+ crypto_free(tmp);
+ return err_status_bad_param;
+ }
+
+ return err_status_ok;
+}
+
+
+err_status_t
+srtp_create(srtp_t *session, /* handle for session */
+ const srtp_policy_t *policy) { /* SRTP policy (list) */
+ err_status_t stat;
+ srtp_ctx_t *ctx;
+
+ /* sanity check arguments */
+ if (session == NULL)
+ return err_status_bad_param;
+
+ /* allocate srtp context and set ctx_ptr */
+ ctx = (srtp_ctx_t *) crypto_alloc(sizeof(srtp_ctx_t));
+ if (ctx == NULL)
+ return err_status_alloc_fail;
+ *session = ctx;
+
+ /*
+ * loop over elements in the policy list, allocating and
+ * initializing a stream for each element
+ */
+ ctx->stream_template = NULL;
+ ctx->stream_list = NULL;
+ while (policy != NULL) {
+
+ stat = srtp_add_stream(ctx, policy);
+ if (stat) {
+ /* clean up everything */
+ srtp_dealloc(*session);
+ return stat;
+ }
+
+ /* set policy to next item in list */
+ policy = policy->next;
+ }
+
+ return err_status_ok;
+}
+
+
+err_status_t
+srtp_remove_stream(srtp_t session, uint32_t ssrc) {
+ srtp_stream_ctx_t *stream, *last_stream;
+ err_status_t status;
+
+ /* sanity check arguments */
+ if (session == NULL)
+ return err_status_bad_param;
+
+ /* find stream in list; complain if not found */
+ last_stream = stream = session->stream_list;
+ while ((stream != NULL) && (ssrc != stream->ssrc)) {
+ last_stream = stream;
+ stream = stream->next;
+ }
+ if (stream == NULL)
+ return err_status_no_ctx;
+
+ /* remove stream from the list */
+ last_stream->next = stream->next;
+
+ /* deallocate the stream */
+ status = srtp_stream_dealloc(session, stream);
+ if (status)
+ return status;
+
+ return err_status_ok;
+}
+
+
+/*
+ * the default policy - provides a convenient way for callers to use
+ * the default security policy
+ *
+ * this policy is that defined in the current SRTP internet draft.
+ *
+ */
+
+/*
+ * NOTE: cipher_key_len is really key len (128 bits) plus salt len
+ * (112 bits)
+ */
+/* There are hard-coded 16's for base_key_len in the key generation code */
+
+void
+crypto_policy_set_rtp_default(crypto_policy_t *p) {
+
+ p->cipher_type = AES_128_ICM;
+ p->cipher_key_len = 30; /* default 128 bits per RFC 3711 */
+ p->auth_type = HMAC_SHA1;
+ p->auth_key_len = 20; /* default 160 bits per RFC 3711 */
+ p->auth_tag_len = 10; /* default 80 bits per RFC 3711 */
+ p->sec_serv = sec_serv_conf_and_auth;
+
+}
+
+void
+crypto_policy_set_rtcp_default(crypto_policy_t *p) {
+
+ p->cipher_type = AES_128_ICM;
+ p->cipher_key_len = 30; /* default 128 bits per RFC 3711 */
+ p->auth_type = HMAC_SHA1;
+ p->auth_key_len = 20; /* default 160 bits per RFC 3711 */
+ p->auth_tag_len = 10; /* default 80 bits per RFC 3711 */
+ p->sec_serv = sec_serv_conf_and_auth;
+
+}
+
+void
+crypto_policy_set_aes_cm_128_hmac_sha1_32(crypto_policy_t *p) {
+
+ /*
+ * corresponds to draft-ietf-mmusic-sdescriptions-12.txt
+ *
+ * note that this crypto policy is intended for SRTP, but not SRTCP
+ */
+
+ p->cipher_type = AES_128_ICM;
+ p->cipher_key_len = 30; /* 128 bit key, 112 bit salt */
+ p->auth_type = HMAC_SHA1;
+ p->auth_key_len = 20; /* 160 bit key */
+ p->auth_tag_len = 4; /* 32 bit tag */
+ p->sec_serv = sec_serv_conf_and_auth;
+
+}
+
+
+void
+crypto_policy_set_aes_cm_128_null_auth(crypto_policy_t *p) {
+
+ /*
+ * corresponds to draft-ietf-mmusic-sdescriptions-12.txt
+ *
+ * note that this crypto policy is intended for SRTP, but not SRTCP
+ */
+
+ p->cipher_type = AES_128_ICM;
+ p->cipher_key_len = 30; /* 128 bit key, 112 bit salt */
+ p->auth_type = NULL_AUTH;
+ p->auth_key_len = 0;
+ p->auth_tag_len = 0;
+ p->sec_serv = sec_serv_conf;
+
+}
+
+
+void
+crypto_policy_set_null_cipher_hmac_sha1_80(crypto_policy_t *p) {
+
+ /*
+ * corresponds to draft-ietf-mmusic-sdescriptions-12.txt
+ */
+
+ p->cipher_type = NULL_CIPHER;
+ p->cipher_key_len = 0;
+ p->auth_type = HMAC_SHA1;
+ p->auth_key_len = 20;
+ p->auth_tag_len = 10;
+ p->sec_serv = sec_serv_auth;
+
+}
+
+
+/*
+ * secure rtcp functions
+ */
+
+err_status_t
+srtp_protect_rtcp(srtp_t ctx, void *rtcp_hdr, int *pkt_octet_len) {
+ srtcp_hdr_t *hdr = (srtcp_hdr_t *)rtcp_hdr;
+ uint32_t *enc_start; /* pointer to start of encrypted portion */
+ uint32_t *auth_start; /* pointer to start of auth. portion */
+ uint32_t *trailer; /* pointer to start of trailer */
+ unsigned enc_octet_len = 0;/* number of octets in encrypted portion */
+ uint8_t *auth_tag = NULL; /* location of auth_tag within packet */
+ err_status_t status;
+ int tag_len;
+ srtp_stream_ctx_t *stream;
+ int prefix_len;
+ uint32_t seq_num;
+
+ /* we assume the hdr is 32-bit aligned to start */
+ /*
+ * look up ssrc in srtp_stream list, and process the packet with
+ * the appropriate stream. if we haven't seen this stream before,
+ * there's only one key for this srtp_session, and the cipher
+ * supports key-sharing, then we assume that a new stream using
+ * that key has just started up
+ */
+ stream = srtp_get_stream(ctx, hdr->ssrc);
+ if (stream == NULL) {
+ if (ctx->stream_template != NULL) {
+ srtp_stream_ctx_t *new_stream;
+
+ /* allocate and initialize a new stream */
+ status = srtp_stream_clone(ctx->stream_template,
+ hdr->ssrc, &new_stream);
+ if (status)
+ return status;
+
+ /* add new stream to the head of the stream_list */
+ new_stream->next = ctx->stream_list;
+ ctx->stream_list = new_stream;
+
+ /* set stream (the pointer used in this function) */
+ stream = new_stream;
+ } else {
+ /* no template stream, so we return an error */
+ return err_status_no_ctx;
+ }
+ }
+
+ /*
+ * verify that stream is for sending traffic - this check will
+ * detect SSRC collisions, since a stream that appears in both
+ * srtp_protect() and srtp_unprotect() will fail this test in one of
+ * those functions.
+ */
+ if (stream->direction != dir_srtp_sender) {
+ if (stream->direction == dir_unknown) {
+ stream->direction = dir_srtp_sender;
+ } else {
+ srtp_handle_event(ctx, stream, event_ssrc_collision);
+ }
+ }
+
+ /* get tag length from stream context */
+ tag_len = auth_get_tag_length(stream->rtcp_auth);
+
+ /*
+ * set encryption start and encryption length - if we're not
+ * providing confidentiality, set enc_start to NULL
+ */
+ enc_start = (uint32_t *)hdr + uint32s_in_rtcp_header;
+ enc_octet_len = *pkt_octet_len - octets_in_rtcp_header;
+
+ /* all of the packet, except the header, gets encrypted */
+ /* NOTE: hdr->length is not usable - it refers to only the first
+ RTCP report in the compound packet! */
+ /* NOTE: trailer is 32-bit aligned because RTCP 'packets' are always
+ multiples of 32-bits (RFC 3550 6.1) */
+ trailer = (uint32_t *) ((char *)enc_start + enc_octet_len);
+
+ if (stream->rtcp_services & sec_serv_conf) {
+ *trailer = htonl(SRTCP_E_BIT); /* set encrypt bit */
+ } else {
+ enc_start = NULL;
+ enc_octet_len = 0;
+ /* 0 is network-order independant */
+ *trailer = 0x00000000; /* set encrypt bit */
+ }
+
+ /*
+ * set the auth_start and auth_tag pointers to the proper locations
+ * (note that srtpc *always* provides authentication, unlike srtp)
+ */
+ /* Note: This would need to change for optional mikey data */
+ auth_start = (uint32_t *)hdr;
+ auth_tag = (uint8_t *)hdr + *pkt_octet_len + sizeof(srtcp_trailer_t);
+
+ /*
+ * check sequence number for overruns, and copy it into the packet
+ * if its value isn't too big
+ */
+ status = rdb_increment(&stream->rtcp_rdb);
+ if (status)
+ return status;
+ seq_num = rdb_get_value(&stream->rtcp_rdb);
+ *trailer |= htonl(seq_num);
+ debug_print(mod_srtp, "srtcp index: %x", seq_num);
+
+ /*
+ * if we're using rindael counter mode, set nonce and seq
+ */
+ if (stream->rtcp_cipher->type == &aes_icm) {
+ v128_t iv;
+
+ iv.v32[0] = 0;
+ iv.v32[1] = hdr->ssrc; /* still in network order! */
+ iv.v32[2] = htonl(seq_num >> 16);
+ iv.v32[3] = htonl(seq_num << 16);
+ status = aes_icm_set_iv((aes_icm_ctx_t*)stream->rtcp_cipher->state, &iv);
+
+ } else {
+ v128_t iv;
+
+ /* otherwise, just set the index to seq_num */
+ iv.v32[0] = 0;
+ iv.v32[1] = 0;
+ iv.v32[2] = 0;
+ iv.v32[3] = htonl(seq_num);
+ status = cipher_set_iv(stream->rtcp_cipher, &iv);
+ }
+ if (status)
+ return err_status_cipher_fail;
+
+ /*
+ * if we're authenticating using a universal hash, put the keystream
+ * prefix into the authentication tag
+ */
+
+ /* if auth_start is non-null, then put keystream into tag */
+ if (auth_start) {
+
+ /* put keystream prefix into auth_tag */
+ prefix_len = auth_get_prefix_length(stream->rtcp_auth);
+ status = cipher_output(stream->rtcp_cipher, auth_tag, prefix_len);
+
+ debug_print(mod_srtp, "keystream prefix: %s",
+ octet_string_hex_string(auth_tag, prefix_len));
+
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /* if we're encrypting, exor keystream into the message */
+ if (enc_start) {
+ status = cipher_encrypt(stream->rtcp_cipher,
+ (uint8_t *)enc_start, &enc_octet_len);
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /* initialize auth func context */
+ auth_start(stream->rtcp_auth);
+
+ /*
+ * run auth func over packet (including trailer), and write the
+ * result at auth_tag
+ */
+ status = auth_compute(stream->rtcp_auth,
+ (uint8_t *)auth_start,
+ (*pkt_octet_len) + sizeof(srtcp_trailer_t),
+ auth_tag);
+ debug_print(mod_srtp, "srtcp auth tag: %s",
+ octet_string_hex_string(auth_tag, tag_len));
+ if (status)
+ return err_status_auth_fail;
+
+ /* increase the packet length by the length of the auth tag and seq_num*/
+ *pkt_octet_len += (tag_len + sizeof(srtcp_trailer_t));
+
+ return err_status_ok;
+}
+
+
+err_status_t
+srtp_unprotect_rtcp(srtp_t ctx, void *srtcp_hdr, int *pkt_octet_len) {
+ srtcp_hdr_t *hdr = (srtcp_hdr_t *)srtcp_hdr;
+ uint32_t *enc_start; /* pointer to start of encrypted portion */
+ uint32_t *auth_start; /* pointer to start of auth. portion */
+ uint32_t *trailer; /* pointer to start of trailer */
+ unsigned enc_octet_len = 0;/* number of octets in encrypted portion */
+ uint8_t *auth_tag = NULL; /* location of auth_tag within packet */
+ uint8_t tmp_tag[SRTP_MAX_TAG_LEN];
+ err_status_t status;
+ int tag_len;
+ srtp_stream_ctx_t *stream;
+ int prefix_len;
+ uint32_t seq_num;
+
+ /* we assume the hdr is 32-bit aligned to start */
+ /*
+ * look up ssrc in srtp_stream list, and process the packet with
+ * the appropriate stream. if we haven't seen this stream before,
+ * there's only one key for this srtp_session, and the cipher
+ * supports key-sharing, then we assume that a new stream using
+ * that key has just started up
+ */
+ stream = srtp_get_stream(ctx, hdr->ssrc);
+ if (stream == NULL) {
+ if (ctx->stream_template != NULL) {
+ stream = ctx->stream_template;
+ debug_print(mod_srtp, "srtcp using provisional stream (SSRC: 0x%08x)",
+ hdr->ssrc);
+ } else {
+ /* no template stream, so we return an error */
+ return err_status_no_ctx;
+ }
+ }
+
+ /* get tag length from stream context */
+ tag_len = auth_get_tag_length(stream->rtcp_auth);
+
+ /*
+ * set encryption start, encryption length, and trailer
+ */
+ enc_octet_len = *pkt_octet_len -
+ (octets_in_rtcp_header + tag_len + sizeof(srtcp_trailer_t));
+ /* index & E (encryption) bit follow normal data. hdr->len
+ is the number of words (32-bit) in the normal packet minus 1 */
+ /* This should point trailer to the word past the end of the
+ normal data. */
+ /* This would need to be modified for optional mikey data */
+ /*
+ * NOTE: trailer is 32-bit aligned because RTCP 'packets' are always
+ * multiples of 32-bits (RFC 3550 6.1)
+ */
+ trailer = (uint32_t *) ((char *) hdr +
+ *pkt_octet_len -(tag_len + sizeof(srtcp_trailer_t)));
+ if (*((unsigned char *) trailer) & SRTCP_E_BYTE_BIT) {
+ enc_start = (uint32_t *)hdr + uint32s_in_rtcp_header;
+ } else {
+ enc_octet_len = 0;
+ enc_start = NULL; /* this indicates that there's no encryption */
+ }
+
+ /*
+ * set the auth_start and auth_tag pointers to the proper locations
+ * (note that srtcp *always* uses authentication, unlike srtp)
+ */
+ auth_start = (uint32_t *)hdr;
+ auth_tag = (uint8_t *)hdr + *pkt_octet_len - tag_len;
+
+ /*
+ * check the sequence number for replays
+ */
+ /* this is easier than dealing with bitfield access */
+ seq_num = ntohl(*trailer) & SRTCP_INDEX_MASK;
+ debug_print(mod_srtp, "srtcp index: %x", seq_num);
+ status = rdb_check(&stream->rtcp_rdb, seq_num);
+ if (status)
+ return status;
+
+ /*
+ * if we're using aes counter mode, set nonce and seq
+ */
+ if (stream->rtcp_cipher->type == &aes_icm) {
+ v128_t iv;
+
+ iv.v32[0] = 0;
+ iv.v32[1] = hdr->ssrc; /* still in network order! */
+ iv.v32[2] = htonl(seq_num >> 16);
+ iv.v32[3] = htonl(seq_num << 16);
+ status = aes_icm_set_iv((aes_icm_ctx_t*)stream->rtcp_cipher->state, &iv);
+
+ } else {
+ v128_t iv;
+
+ /* otherwise, just set the index to seq_num */
+ iv.v32[0] = 0;
+ iv.v32[1] = 0;
+ iv.v32[2] = 0;
+ iv.v32[3] = htonl(seq_num);
+ status = cipher_set_iv(stream->rtcp_cipher, &iv);
+
+ }
+ if (status)
+ return err_status_cipher_fail;
+
+ /* initialize auth func context */
+ auth_start(stream->rtcp_auth);
+
+ /* run auth func over packet, put result into tmp_tag */
+ status = auth_compute(stream->rtcp_auth, (uint8_t *)auth_start,
+ *pkt_octet_len - tag_len,
+ tmp_tag);
+ debug_print(mod_srtp, "srtcp computed tag: %s",
+ octet_string_hex_string(tmp_tag, tag_len));
+ if (status)
+ return err_status_auth_fail;
+
+ /* compare the tag just computed with the one in the packet */
+ debug_print(mod_srtp, "srtcp tag from packet: %s",
+ octet_string_hex_string(auth_tag, tag_len));
+ if (octet_string_is_eq(tmp_tag, auth_tag, tag_len))
+ return err_status_auth_fail;
+
+ /*
+ * if we're authenticating using a universal hash, put the keystream
+ * prefix into the authentication tag
+ */
+ prefix_len = auth_get_prefix_length(stream->rtcp_auth);
+ if (prefix_len) {
+ status = cipher_output(stream->rtcp_cipher, auth_tag, prefix_len);
+ debug_print(mod_srtp, "keystream prefix: %s",
+ octet_string_hex_string(auth_tag, prefix_len));
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /* if we're decrypting, exor keystream into the message */
+ if (enc_start) {
+ status = cipher_encrypt(stream->rtcp_cipher,
+ (uint8_t *)enc_start, &enc_octet_len);
+ if (status)
+ return err_status_cipher_fail;
+ }
+
+ /* decrease the packet length by the length of the auth tag and seq_num*/
+ *pkt_octet_len -= (tag_len + sizeof(srtcp_trailer_t));
+
+ /*
+ * verify that stream is for received traffic - this check will
+ * detect SSRC collisions, since a stream that appears in both
+ * srtp_protect() and srtp_unprotect() will fail this test in one of
+ * those functions.
+ *
+ * we do this check *after* the authentication check, so that the
+ * latter check will catch any attempts to fool us into thinking
+ * that we've got a collision
+ */
+ if (stream->direction != dir_srtp_receiver) {
+ if (stream->direction == dir_unknown) {
+ stream->direction = dir_srtp_receiver;
+ } else {
+ srtp_handle_event(ctx, stream, event_ssrc_collision);
+ }
+ }
+
+ /*
+ * if the stream is a 'provisional' one, in which the template context
+ * is used, then we need to allocate a new stream at this point, since
+ * the authentication passed
+ */
+ if (stream == ctx->stream_template) {
+ srtp_stream_ctx_t *new_stream;
+
+ /*
+ * allocate and initialize a new stream
+ *
+ * note that we indicate failure if we can't allocate the new
+ * stream, and some implementations will want to not return
+ * failure here
+ */
+ status = srtp_stream_clone(ctx->stream_template, hdr->ssrc, &new_stream);
+ if (status)
+ return status;
+
+ /* add new stream to the head of the stream_list */
+ new_stream->next = ctx->stream_list;
+ ctx->stream_list = new_stream;
+
+ /* set stream (the pointer used in this function) */
+ stream = new_stream;
+ }
+
+ /* we've passed the authentication check, so add seq_num to the rdb */
+ rdb_add_index(&stream->rtcp_rdb, seq_num);
+
+
+ return err_status_ok;
+}
+
+
+
+/*
+ * dtls keying for srtp
+ */
+
+err_status_t
+crypto_policy_set_from_profile_for_rtp(crypto_policy_t *policy,
+ srtp_profile_t profile) {
+
+ /* set SRTP policy from the SRTP profile in the key set */
+ switch(profile) {
+ case srtp_profile_aes128_cm_sha1_80:
+ crypto_policy_set_aes_cm_128_hmac_sha1_80(policy);
+ break;
+ case srtp_profile_aes128_cm_sha1_32:
+ crypto_policy_set_aes_cm_128_hmac_sha1_32(policy);
+ break;
+ case srtp_profile_null_sha1_80:
+ crypto_policy_set_null_cipher_hmac_sha1_80(policy);
+ break;
+ /* the following profiles are not (yet) supported */
+ case srtp_profile_null_sha1_32:
+ case srtp_profile_aes256_cm_sha1_80:
+ case srtp_profile_aes256_cm_sha1_32:
+ default:
+ return err_status_bad_param;
+ }
+
+ return err_status_ok;
+}
+
+err_status_t
+crypto_policy_set_from_profile_for_rtcp(crypto_policy_t *policy,
+ srtp_profile_t profile) {
+
+ /* set SRTP policy from the SRTP profile in the key set */
+ switch(profile) {
+ case srtp_profile_aes128_cm_sha1_80:
+ crypto_policy_set_aes_cm_128_hmac_sha1_80(policy);
+ break;
+ case srtp_profile_aes128_cm_sha1_32:
+ crypto_policy_set_aes_cm_128_hmac_sha1_32(policy);
+ break;
+ case srtp_profile_null_sha1_80:
+ crypto_policy_set_null_cipher_hmac_sha1_80(policy);
+ break;
+ /* the following profiles are not (yet) supported */
+ case srtp_profile_null_sha1_32:
+ case srtp_profile_aes256_cm_sha1_80:
+ case srtp_profile_aes256_cm_sha1_32:
+ default:
+ return err_status_bad_param;
+ }
+
+ return err_status_ok;
+}
+
+void
+append_salt_to_key(uint8_t *key, unsigned int bytes_in_key,
+ uint8_t *salt, unsigned int bytes_in_salt) {
+
+ memcpy(key + bytes_in_key, salt, bytes_in_salt);
+
+}
+
+unsigned int
+srtp_profile_get_master_key_length(srtp_profile_t profile) {
+
+ switch(profile) {
+ case srtp_profile_aes128_cm_sha1_80:
+ return 16;
+ break;
+ case srtp_profile_aes128_cm_sha1_32:
+ return 16;
+ break;
+ case srtp_profile_null_sha1_80:
+ return 16;
+ break;
+ /* the following profiles are not (yet) supported */
+ case srtp_profile_null_sha1_32:
+ case srtp_profile_aes256_cm_sha1_80:
+ case srtp_profile_aes256_cm_sha1_32:
+ default:
+ return 0; /* indicate error by returning a zero */
+ }
+}
+
+unsigned int
+srtp_profile_get_master_salt_length(srtp_profile_t profile) {
+
+ switch(profile) {
+ case srtp_profile_aes128_cm_sha1_80:
+ return 14;
+ break;
+ case srtp_profile_aes128_cm_sha1_32:
+ return 14;
+ break;
+ case srtp_profile_null_sha1_80:
+ return 14;
+ break;
+ /* the following profiles are not (yet) supported */
+ case srtp_profile_null_sha1_32:
+ case srtp_profile_aes256_cm_sha1_80:
+ case srtp_profile_aes256_cm_sha1_32:
+ default:
+ return 0; /* indicate error by returning a zero */
+ }
+}
diff --git a/jni/pjproject-android/.svn/pristine/9f/9f926e862b0d869f490e9fafbfd83a18323a264f.svn-base b/jni/pjproject-android/.svn/pristine/9f/9f926e862b0d869f490e9fafbfd83a18323a264f.svn-base
new file mode 100644
index 0000000..f5208b6
--- /dev/null
+++ b/jni/pjproject-android/.svn/pristine/9f/9f926e862b0d869f490e9fafbfd83a18323a264f.svn-base
@@ -0,0 +1,18 @@
+//{{NO_DEPENDENCIES}}
+// Microsoft Visual C++ generated include file.
+// Used by pjsystest_wince.rc
+//
+#define IDD_MAIN_DIALOG 101
+#define IDS_MAIN_TITLE 102
+#define IDC_EDIT1 1001
+
+// Next default values for new objects
+//
+#ifdef APSTUDIO_INVOKED
+#ifndef APSTUDIO_READONLY_SYMBOLS
+#define _APS_NEXT_RESOURCE_VALUE 103
+#define _APS_NEXT_COMMAND_VALUE 40001
+#define _APS_NEXT_CONTROL_VALUE 1002
+#define _APS_NEXT_SYMED_VALUE 101
+#endif
+#endif
diff --git a/jni/pjproject-android/.svn/pristine/9f/9fa7bda04dbe84b039b932b9f08a2b7b32671218.svn-base b/jni/pjproject-android/.svn/pristine/9f/9fa7bda04dbe84b039b932b9f08a2b7b32671218.svn-base
new file mode 100644
index 0000000..14f17cd
--- /dev/null
+++ b/jni/pjproject-android/.svn/pristine/9f/9fa7bda04dbe84b039b932b9f08a2b7b32671218.svn-base
@@ -0,0 +1,1587 @@
+//------------------------------------------------------------------------------
+// File: AMFilter.h
+//
+// Desc: DirectShow base classes - efines class hierarchy for streams
+// architecture.
+//
+// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved.
+//------------------------------------------------------------------------------
+
+
+#ifndef __FILTER__
+#define __FILTER__
+
+/* The following classes are declared in this header: */
+
+class CBaseMediaFilter; // IMediaFilter support
+class CBaseFilter; // IBaseFilter,IMediaFilter support
+class CBasePin; // Abstract base class for IPin interface
+class CEnumPins; // Enumerate input and output pins
+class CEnumMediaTypes; // Enumerate the pin's preferred formats
+class CBaseOutputPin; // Adds data provider member functions
+class CBaseInputPin; // Implements IMemInputPin interface
+class CMediaSample; // Basic transport unit for IMemInputPin
+class CBaseAllocator; // General list guff for most allocators
+class CMemAllocator; // Implements memory buffer allocation
+
+
+//=====================================================================
+//=====================================================================
+//
+// QueryFilterInfo and QueryPinInfo AddRef the interface pointers
+// they return. You can use the macro below to release the interface.
+//
+//=====================================================================
+//=====================================================================
+
+#define QueryFilterInfoReleaseGraph(fi) if ((fi).pGraph) (fi).pGraph->Release();
+
+#define QueryPinInfoReleaseFilter(pi) if ((pi).pFilter) (pi).pFilter->Release();
+
+//=====================================================================
+//=====================================================================
+// Defines CBaseMediaFilter
+//
+// Abstract base class implementing IMediaFilter.
+//
+// Typically you will derive your filter from CBaseFilter rather than
+// this, unless you are implementing an object such as a plug-in
+// distributor that needs to support IMediaFilter but not IBaseFilter.
+//
+// Note that IMediaFilter is derived from IPersist to allow query of
+// class id.
+//=====================================================================
+//=====================================================================
+
+class AM_NOVTABLE CBaseMediaFilter : public CUnknown,
+ public IMediaFilter
+{
+
+protected:
+
+ FILTER_STATE m_State; // current state: running, paused
+ IReferenceClock *m_pClock; // this filter's reference clock
+ // note: all filters in a filter graph use the same clock
+
+ // offset from stream time to reference time
+ CRefTime m_tStart;
+
+ CLSID m_clsid; // This filters clsid
+ // used for serialization
+ CCritSec *m_pLock; // Object we use for locking
+
+public:
+
+ CBaseMediaFilter(
+ __in_opt LPCTSTR pName,
+ __inout_opt LPUNKNOWN pUnk,
+ __in CCritSec *pLock,
+ REFCLSID clsid);
+
+ virtual ~CBaseMediaFilter();
+
+ DECLARE_IUNKNOWN
+
+ // override this to say what interfaces we support where
+ STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv);
+
+ //
+ // --- IPersist method ---
+ //
+
+ STDMETHODIMP GetClassID(__out CLSID *pClsID);
+
+ // --- IMediaFilter methods ---
+
+ STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State);
+
+ STDMETHODIMP SetSyncSource(__inout_opt IReferenceClock *pClock);
+
+ STDMETHODIMP GetSyncSource(__deref_out_opt IReferenceClock **pClock);
+
+ // default implementation of Stop and Pause just record the
+ // state. Override to activate or de-activate your filter.
+ // Note that Run when called from Stopped state will call Pause
+ // to ensure activation, so if you are a source or transform
+ // you will probably not need to override Run.
+ STDMETHODIMP Stop();
+ STDMETHODIMP Pause();
+
+
+ // the start parameter is the difference to be added to the
+ // sample's stream time to get the reference time for
+ // its presentation
+ STDMETHODIMP Run(REFERENCE_TIME tStart);
+
+ // --- helper methods ---
+
+ // return the current stream time - ie find out what
+ // stream time should be appearing now
+ virtual HRESULT StreamTime(CRefTime& rtStream);
+
+ // Is the filter currently active? (running or paused)
+ BOOL IsActive() {
+ CAutoLock cObjectLock(m_pLock);
+ return ((m_State == State_Paused) || (m_State == State_Running));
+ };
+};
+
+//=====================================================================
+//=====================================================================
+// Defines CBaseFilter
+//
+// An abstract class providing basic IBaseFilter support for pin
+// enumeration and filter information reading.
+//
+// We cannot derive from CBaseMediaFilter since methods in IMediaFilter
+// are also in IBaseFilter and would be ambiguous. Since much of the code
+// assumes that they derive from a class that has m_State and other state
+// directly available, we duplicate code from CBaseMediaFilter rather than
+// having a member variable.
+//
+// Derive your filter from this, or from a derived object such as
+// CTransformFilter.
+//=====================================================================
+//=====================================================================
+
+
+class AM_NOVTABLE CBaseFilter : public CUnknown, // Handles an IUnknown
+ public IBaseFilter, // The Filter Interface
+ public IAMovieSetup // For un/registration
+{
+
+friend class CBasePin;
+
+protected:
+ FILTER_STATE m_State; // current state: running, paused
+ IReferenceClock *m_pClock; // this graph's ref clock
+ CRefTime m_tStart; // offset from stream time to reference time
+ CLSID m_clsid; // This filters clsid
+ // used for serialization
+ CCritSec *m_pLock; // Object we use for locking
+
+ WCHAR *m_pName; // Full filter name
+ IFilterGraph *m_pGraph; // Graph we belong to
+ IMediaEventSink *m_pSink; // Called with notify events
+ LONG m_PinVersion; // Current pin version
+
+public:
+
+ CBaseFilter(
+ __in_opt LPCTSTR pName, // Object description
+ __inout_opt LPUNKNOWN pUnk, // IUnknown of delegating object
+ __in CCritSec *pLock, // Object who maintains lock
+ REFCLSID clsid); // The clsid to be used to serialize this filter
+
+ CBaseFilter(
+ __in_opt LPCTSTR pName, // Object description
+ __in_opt LPUNKNOWN pUnk, // IUnknown of delegating object
+ __in CCritSec *pLock, // Object who maintains lock
+ REFCLSID clsid, // The clsid to be used to serialize this filter
+ __inout HRESULT *phr); // General OLE return code
+#ifdef UNICODE
+ CBaseFilter(
+ __in_opt LPCSTR pName, // Object description
+ __in_opt LPUNKNOWN pUnk, // IUnknown of delegating object
+ __in CCritSec *pLock, // Object who maintains lock
+ REFCLSID clsid); // The clsid to be used to serialize this filter
+
+ CBaseFilter(
+ __in_opt LPCSTR pName, // Object description
+ __in_opt LPUNKNOWN pUnk, // IUnknown of delegating object
+ __in CCritSec *pLock, // Object who maintains lock
+ REFCLSID clsid, // The clsid to be used to serialize this filter
+ __inout HRESULT *phr); // General OLE return code
+#endif
+ ~CBaseFilter();
+
+ DECLARE_IUNKNOWN
+
+ // override this to say what interfaces we support where
+ STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv);
+#ifdef DEBUG
+ STDMETHODIMP_(ULONG) NonDelegatingRelease();
+#endif
+
+ //
+ // --- IPersist method ---
+ //
+
+ STDMETHODIMP GetClassID(__out CLSID *pClsID);
+
+ // --- IMediaFilter methods ---
+
+ STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State);
+
+ STDMETHODIMP SetSyncSource(__in_opt IReferenceClock *pClock);
+
+ STDMETHODIMP GetSyncSource(__deref_out_opt IReferenceClock **pClock);
+
+
+ // override Stop and Pause so we can activate the pins.
+ // Note that Run will call Pause first if activation needed.
+ // Override these if you want to activate your filter rather than
+ // your pins.
+ STDMETHODIMP Stop();
+ STDMETHODIMP Pause();
+
+ // the start parameter is the difference to be added to the
+ // sample's stream time to get the reference time for
+ // its presentation
+ STDMETHODIMP Run(REFERENCE_TIME tStart);
+
+ // --- helper methods ---
+
+ // return the current stream time - ie find out what
+ // stream time should be appearing now
+ virtual HRESULT StreamTime(CRefTime& rtStream);
+
+ // Is the filter currently active?
+ BOOL IsActive() {
+ CAutoLock cObjectLock(m_pLock);
+ return ((m_State == State_Paused) || (m_State == State_Running));
+ };
+
+ // Is this filter stopped (without locking)
+ BOOL IsStopped() {
+ return (m_State == State_Stopped);
+ };
+
+ //
+ // --- IBaseFilter methods ---
+ //
+
+ // pin enumerator
+ STDMETHODIMP EnumPins(
+ __deref_out IEnumPins ** ppEnum);
+
+
+ // default behaviour of FindPin assumes pin ids are their names
+ STDMETHODIMP FindPin(
+ LPCWSTR Id,
+ __deref_out IPin ** ppPin
+ );
+
+ STDMETHODIMP QueryFilterInfo(
+ __out FILTER_INFO * pInfo);
+
+ STDMETHODIMP JoinFilterGraph(
+ __inout_opt IFilterGraph * pGraph,
+ __in_opt LPCWSTR pName);
+
+ // return a Vendor information string. Optional - may return E_NOTIMPL.
+ // memory returned should be freed using CoTaskMemFree
+ // default implementation returns E_NOTIMPL
+ STDMETHODIMP QueryVendorInfo(
+ __deref_out LPWSTR* pVendorInfo
+ );
+
+ // --- helper methods ---
+
+ // send an event notification to the filter graph if we know about it.
+ // returns S_OK if delivered, S_FALSE if the filter graph does not sink
+ // events, or an error otherwise.
+ HRESULT NotifyEvent(
+ long EventCode,
+ LONG_PTR EventParam1,
+ LONG_PTR EventParam2);
+
+ // return the filter graph we belong to
+ __out_opt IFilterGraph *GetFilterGraph() {
+ return m_pGraph;
+ }
+
+ // Request reconnect
+ // pPin is the pin to reconnect
+ // pmt is the type to reconnect with - can be NULL
+ // Calls ReconnectEx on the filter graph
+ HRESULT ReconnectPin(IPin *pPin, __in_opt AM_MEDIA_TYPE const *pmt);
+
+ // find out the current pin version (used by enumerators)
+ virtual LONG GetPinVersion();
+ void IncrementPinVersion();
+
+ // you need to supply these to access the pins from the enumerator
+ // and for default Stop and Pause/Run activation.
+ virtual int GetPinCount() PURE;
+ virtual CBasePin *GetPin(int n) PURE;
+
+ // --- IAMovieSetup methods ---
+
+ STDMETHODIMP Register(); // ask filter to register itself
+ STDMETHODIMP Unregister(); // and unregister itself
+
+ // --- setup helper methods ---
+ // (override to return filters setup data)
+
+ virtual __out_opt LPAMOVIESETUP_FILTER GetSetupData(){ return NULL; }
+
+};
+
+
+//=====================================================================
+//=====================================================================
+// Defines CBasePin
+//
+// Abstract class that supports the basics of IPin
+//=====================================================================
+//=====================================================================
+
+class AM_NOVTABLE CBasePin : public CUnknown, public IPin, public IQualityControl
+{
+
+protected:
+
+ WCHAR * m_pName; // This pin's name
+ IPin *m_Connected; // Pin we have connected to
+ PIN_DIRECTION m_dir; // Direction of this pin
+ CCritSec *m_pLock; // Object we use for locking
+ bool m_bRunTimeError; // Run time error generated
+ bool m_bCanReconnectWhenActive; // OK to reconnect when active
+ bool m_bTryMyTypesFirst; // When connecting enumerate
+ // this pin's types first
+ CBaseFilter *m_pFilter; // Filter we were created by
+ IQualityControl *m_pQSink; // Target for Quality messages
+ LONG m_TypeVersion; // Holds current type version
+ CMediaType m_mt; // Media type of connection
+
+ CRefTime m_tStart; // time from NewSegment call
+ CRefTime m_tStop; // time from NewSegment
+ double m_dRate; // rate from NewSegment
+
+#ifdef DEBUG
+ LONG m_cRef; // Ref count tracing
+#endif
+
+ // displays pin connection information
+
+#ifdef DEBUG
+ void DisplayPinInfo(IPin *pReceivePin);
+ void DisplayTypeInfo(IPin *pPin, const CMediaType *pmt);
+#else
+ void DisplayPinInfo(IPin *pReceivePin) {};
+ void DisplayTypeInfo(IPin *pPin, const CMediaType *pmt) {};
+#endif
+
+ // used to agree a media type for a pin connection
+
+ // given a specific media type, attempt a connection (includes
+ // checking that the type is acceptable to this pin)
+ HRESULT
+ AttemptConnection(
+ IPin* pReceivePin, // connect to this pin
+ const CMediaType* pmt // using this type
+ );
+
+ // try all the media types in this enumerator - for each that
+ // we accept, try to connect using ReceiveConnection.
+ HRESULT TryMediaTypes(
+ IPin *pReceivePin, // connect to this pin
+ __in_opt const CMediaType *pmt, // proposed type from Connect
+ IEnumMediaTypes *pEnum); // try this enumerator
+
+ // establish a connection with a suitable mediatype. Needs to
+ // propose a media type if the pmt pointer is null or partially
+ // specified - use TryMediaTypes on both our and then the other pin's
+ // enumerator until we find one that works.
+ HRESULT AgreeMediaType(
+ IPin *pReceivePin, // connect to this pin
+ const CMediaType *pmt); // proposed type from Connect
+
+public:
+
+ CBasePin(
+ __in_opt LPCTSTR pObjectName, // Object description
+ __in CBaseFilter *pFilter, // Owning filter who knows about pins
+ __in CCritSec *pLock, // Object who implements the lock
+ __inout HRESULT *phr, // General OLE return code
+ __in_opt LPCWSTR pName, // Pin name for us
+ PIN_DIRECTION dir); // Either PINDIR_INPUT or PINDIR_OUTPUT
+#ifdef UNICODE
+ CBasePin(
+ __in_opt LPCSTR pObjectName, // Object description
+ __in CBaseFilter *pFilter, // Owning filter who knows about pins
+ __in CCritSec *pLock, // Object who implements the lock
+ __inout HRESULT *phr, // General OLE return code
+ __in_opt LPCWSTR pName, // Pin name for us
+ PIN_DIRECTION dir); // Either PINDIR_INPUT or PINDIR_OUTPUT
+#endif
+ virtual ~CBasePin();
+
+ DECLARE_IUNKNOWN
+
+ STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv);
+ STDMETHODIMP_(ULONG) NonDelegatingRelease();
+ STDMETHODIMP_(ULONG) NonDelegatingAddRef();
+
+ // --- IPin methods ---
+
+ // take lead role in establishing a connection. Media type pointer
+ // may be null, or may point to partially-specified mediatype
+ // (subtype or format type may be GUID_NULL).
+ STDMETHODIMP Connect(
+ IPin * pReceivePin,
+ __in_opt const AM_MEDIA_TYPE *pmt // optional media type
+ );
+
+ // (passive) accept a connection from another pin
+ STDMETHODIMP ReceiveConnection(
+ IPin * pConnector, // this is the initiating connecting pin
+ const AM_MEDIA_TYPE *pmt // this is the media type we will exchange
+ );
+
+ STDMETHODIMP Disconnect();
+
+ STDMETHODIMP ConnectedTo(__deref_out IPin **pPin);
+
+ STDMETHODIMP ConnectionMediaType(__out AM_MEDIA_TYPE *pmt);
+
+ STDMETHODIMP QueryPinInfo(
+ __out PIN_INFO * pInfo
+ );
+
+ STDMETHODIMP QueryDirection(
+ __out PIN_DIRECTION * pPinDir
+ );
+
+ STDMETHODIMP QueryId(
+ __deref_out LPWSTR * Id
+ );
+
+ // does the pin support this media type
+ STDMETHODIMP QueryAccept(
+ const AM_MEDIA_TYPE *pmt
+ );
+
+ // return an enumerator for this pins preferred media types
+ STDMETHODIMP EnumMediaTypes(
+ __deref_out IEnumMediaTypes **ppEnum
+ );
+
+ // return an array of IPin* - the pins that this pin internally connects to
+ // All pins put in the array must be AddReffed (but no others)
+ // Errors: "Can't say" - FAIL, not enough slots - return S_FALSE
+ // Default: return E_NOTIMPL
+ // The filter graph will interpret NOT_IMPL as any input pin connects to
+ // all visible output pins and vice versa.
+ // apPin can be NULL if nPin==0 (not otherwise).
+ STDMETHODIMP QueryInternalConnections(
+ __out_ecount_part(*nPin,*nPin) IPin* *apPin, // array of IPin*
+ __inout ULONG *nPin // on input, the number of slots
+ // on output the number of pins
+ ) { return E_NOTIMPL; }
+
+ // Called when no more data will be sent
+ STDMETHODIMP EndOfStream(void);
+
+ // Begin/EndFlush still PURE
+
+ // NewSegment notifies of the start/stop/rate applying to the data
+ // about to be received. Default implementation records data and
+ // returns S_OK.
+ // Override this to pass downstream.
+ STDMETHODIMP NewSegment(
+ REFERENCE_TIME tStart,
+ REFERENCE_TIME tStop,
+ double dRate);
+
+ //================================================================================
+ // IQualityControl methods
+ //================================================================================
+
+ STDMETHODIMP Notify(IBaseFilter * pSender, Quality q);
+
+ STDMETHODIMP SetSink(IQualityControl * piqc);
+
+ // --- helper methods ---
+
+ // Returns true if the pin is connected. false otherwise.
+ BOOL IsConnected(void) {return (m_Connected != NULL); };
+ // Return the pin this is connected to (if any)
+ IPin * GetConnected() { return m_Connected; };
+
+ // Check if our filter is currently stopped
+ BOOL IsStopped() {
+ return (m_pFilter->m_State == State_Stopped);
+ };
+
+ // find out the current type version (used by enumerators)
+ virtual LONG GetMediaTypeVersion();
+ void IncrementTypeVersion();
+
+ // switch the pin to active (paused or running) mode
+ // not an error to call this if already active
+ virtual HRESULT Active(void);
+
+ // switch the pin to inactive state - may already be inactive
+ virtual HRESULT Inactive(void);
+
+ // Notify of Run() from filter
+ virtual HRESULT Run(REFERENCE_TIME tStart);
+
+ // check if the pin can support this specific proposed type and format
+ virtual HRESULT CheckMediaType(const CMediaType *) PURE;
+
+ // set the connection to use this format (previously agreed)
+ virtual HRESULT SetMediaType(const CMediaType *);
+
+ // check that the connection is ok before verifying it
+ // can be overridden eg to check what interfaces will be supported.
+ virtual HRESULT CheckConnect(IPin *);
+
+ // Set and release resources required for a connection
+ virtual HRESULT BreakConnect();
+ virtual HRESULT CompleteConnect(IPin *pReceivePin);
+
+ // returns the preferred formats for a pin
+ virtual HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType);
+
+ // access to NewSegment values
+ REFERENCE_TIME CurrentStopTime() {
+ return m_tStop;
+ }
+ REFERENCE_TIME CurrentStartTime() {
+ return m_tStart;
+ }
+ double CurrentRate() {
+ return m_dRate;
+ }
+
+ // Access name
+ LPWSTR Name() { return m_pName; };
+
+ // Can reconnectwhen active?
+ void SetReconnectWhenActive(bool bCanReconnect)
+ {
+ m_bCanReconnectWhenActive = bCanReconnect;
+ }
+
+ bool CanReconnectWhenActive()
+ {
+ return m_bCanReconnectWhenActive;
+ }
+
+protected:
+ STDMETHODIMP DisconnectInternal();
+};
+
+
+//=====================================================================
+//=====================================================================
+// Defines CEnumPins
+//
+// Pin enumerator class that works by calling CBaseFilter. This interface
+// is provided by CBaseFilter::EnumPins and calls GetPinCount() and
+// GetPin() to enumerate existing pins. Needs to be a separate object so
+// that it can be cloned (creating an existing object at the same
+// position in the enumeration)
+//
+//=====================================================================
+//=====================================================================
+
+class CEnumPins : public IEnumPins // The interface we support
+{
+ int m_Position; // Current ordinal position
+ int m_PinCount; // Number of pins available
+ CBaseFilter *m_pFilter; // The filter who owns us
+ LONG m_Version; // Pin version information
+ LONG m_cRef;
+
+ typedef CGenericList<CBasePin> CPinList;
+
+ CPinList m_PinCache; // These pointers have not been AddRef'ed and
+ // so they should not be dereferenced. They are
+ // merely kept to ID which pins have been enumerated.
+
+#ifdef DEBUG
+ DWORD m_dwCookie;
+#endif
+
+ /* If while we are retrieving a pin for example from the filter an error
+ occurs we assume that our internal state is stale with respect to the
+ filter (someone may have deleted all the pins). We can check before
+ starting whether or not the operation is likely to fail by asking the
+ filter what it's current version number is. If the filter has not
+ overriden the GetPinVersion method then this will always match */
+
+ BOOL AreWeOutOfSync() {
+ return (m_pFilter->GetPinVersion() == m_Version ? FALSE : TRUE);
+ };
+
+ /* This method performs the same operations as Reset, except is does not clear
+ the cache of pins already enumerated. */
+
+ STDMETHODIMP Refresh();
+
+public:
+
+ CEnumPins(
+ __in CBaseFilter *pFilter,
+ __in_opt CEnumPins *pEnumPins);
+
+ virtual ~CEnumPins();
+
+ // IUnknown
+ STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv);
+ STDMETHODIMP_(ULONG) AddRef();
+ STDMETHODIMP_(ULONG) Release();
+
+ // IEnumPins
+ STDMETHODIMP Next(
+ ULONG cPins, // place this many pins...
+ __out_ecount(cPins) IPin ** ppPins, // ...in this array of IPin*
+ __out_opt ULONG * pcFetched // actual count passed returned here
+ );
+
+ STDMETHODIMP Skip(ULONG cPins);
+ STDMETHODIMP Reset();
+ STDMETHODIMP Clone(__deref_out IEnumPins **ppEnum);
+
+
+};
+
+
+//=====================================================================
+//=====================================================================
+// Defines CEnumMediaTypes
+//
+// Enumerates the preferred formats for input and output pins
+//=====================================================================
+//=====================================================================
+
+class CEnumMediaTypes : public IEnumMediaTypes // The interface we support
+{
+ int m_Position; // Current ordinal position
+ CBasePin *m_pPin; // The pin who owns us
+ LONG m_Version; // Media type version value
+ LONG m_cRef;
+#ifdef DEBUG
+ DWORD m_dwCookie;
+#endif
+
+ /* The media types a filter supports can be quite dynamic so we add to
+ the general IEnumXXXX interface the ability to be signaled when they
+ change via an event handle the connected filter supplies. Until the
+ Reset method is called after the state changes all further calls to
+ the enumerator (except Reset) will return E_UNEXPECTED error code */
+
+ BOOL AreWeOutOfSync() {
+ return (m_pPin->GetMediaTypeVersion() == m_Version ? FALSE : TRUE);
+ };
+
+public:
+
+ CEnumMediaTypes(
+ __in CBasePin *pPin,
+ __in_opt CEnumMediaTypes *pEnumMediaTypes);
+
+ virtual ~CEnumMediaTypes();
+
+ // IUnknown
+ STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv);
+ STDMETHODIMP_(ULONG) AddRef();
+ STDMETHODIMP_(ULONG) Release();
+
+ // IEnumMediaTypes
+ STDMETHODIMP Next(
+ ULONG cMediaTypes, // place this many pins...
+ __out_ecount(cMediaTypes) AM_MEDIA_TYPE ** ppMediaTypes, // ...in this array
+ __out_opt ULONG * pcFetched // actual count passed
+ );
+
+ STDMETHODIMP Skip(ULONG cMediaTypes);
+ STDMETHODIMP Reset();
+ STDMETHODIMP Clone(__deref_out IEnumMediaTypes **ppEnum);
+};
+
+
+
+
+//=====================================================================
+//=====================================================================
+// Defines CBaseOutputPin
+//
+// class derived from CBasePin that can pass buffers to a connected pin
+// that supports IMemInputPin. Supports IPin.
+//
+// Derive your output pin from this.
+//
+//=====================================================================
+//=====================================================================
+
+class AM_NOVTABLE CBaseOutputPin : public CBasePin
+{
+
+protected:
+
+ IMemAllocator *m_pAllocator;
+ IMemInputPin *m_pInputPin; // interface on the downstreaminput pin
+ // set up in CheckConnect when we connect.
+
+public:
+
+ CBaseOutputPin(
+ __in_opt LPCTSTR pObjectName,
+ __in CBaseFilter *pFilter,
+ __in CCritSec *pLock,
+ __inout HRESULT *phr,
+ __in_opt LPCWSTR pName);
+#ifdef UNICODE
+ CBaseOutputPin(
+ __in_opt LPCSTR pObjectName,
+ __in CBaseFilter *pFilter,
+ __in CCritSec *pLock,
+ __inout HRESULT *phr,
+ __in_opt LPCWSTR pName);
+#endif
+ // override CompleteConnect() so we can negotiate an allocator
+ virtual HRESULT CompleteConnect(IPin *pReceivePin);
+
+ // negotiate the allocator and its buffer size/count and other properties
+ // Calls DecideBufferSize to set properties
+ virtual HRESULT DecideAllocator(IMemInputPin * pPin, __deref_out IMemAllocator ** pAlloc);
+
+ // override this to set the buffer size and count. Return an error
+ // if the size/count is not to your liking.
+ // The allocator properties passed in are those requested by the
+ // input pin - use eg the alignment and prefix members if you have
+ // no preference on these.
+ virtual HRESULT DecideBufferSize(
+ IMemAllocator * pAlloc,
+ __inout ALLOCATOR_PROPERTIES * ppropInputRequest
+ ) PURE;
+
+ // returns an empty sample buffer from the allocator
+ virtual HRESULT GetDeliveryBuffer(__deref_out IMediaSample ** ppSample,
+ __in_opt REFERENCE_TIME * pStartTime,
+ __in_opt REFERENCE_TIME * pEndTime,
+ DWORD dwFlags);
+
+ // deliver a filled-in sample to the connected input pin
+ // note - you need to release it after calling this. The receiving
+ // pin will addref the sample if it needs to hold it beyond the
+ // call.
+ virtual HRESULT Deliver(IMediaSample *);
+
+ // override this to control the connection
+ virtual HRESULT InitAllocator(__deref_out IMemAllocator **ppAlloc);
+ HRESULT CheckConnect(IPin *pPin);
+ HRESULT BreakConnect();
+
+ // override to call Commit and Decommit
+ HRESULT Active(void);
+ HRESULT Inactive(void);
+
+ // we have a default handling of EndOfStream which is to return
+ // an error, since this should be called on input pins only
+ STDMETHODIMP EndOfStream(void);
+
+ // called from elsewhere in our filter to pass EOS downstream to
+ // our connected input pin
+ virtual HRESULT DeliverEndOfStream(void);
+
+ // same for Begin/EndFlush - we handle Begin/EndFlush since it
+ // is an error on an output pin, and we have Deliver methods to
+ // call the methods on the connected pin
+ STDMETHODIMP BeginFlush(void);
+ STDMETHODIMP EndFlush(void);
+ virtual HRESULT DeliverBeginFlush(void);
+ virtual HRESULT DeliverEndFlush(void);
+
+ // deliver NewSegment to connected pin - you will need to
+ // override this if you queue any data in your output pin.
+ virtual HRESULT DeliverNewSegment(
+ REFERENCE_TIME tStart,
+ REFERENCE_TIME tStop,
+ double dRate);
+
+ //================================================================================
+ // IQualityControl methods
+ //================================================================================
+
+ // All inherited from CBasePin and not overridden here.
+ // STDMETHODIMP Notify(IBaseFilter * pSender, Quality q);
+ // STDMETHODIMP SetSink(IQualityControl * piqc);
+};
+
+
+//=====================================================================
+//=====================================================================
+// Defines CBaseInputPin
+//
+// derive your standard input pin from this.
+// you need to supply GetMediaType and CheckConnect etc (see CBasePin),
+// and you need to supply Receive to do something more useful.
+//
+//=====================================================================
+//=====================================================================
+
+class AM_NOVTABLE CBaseInputPin : public CBasePin,
+ public IMemInputPin
+{
+
+protected:
+
+ IMemAllocator *m_pAllocator; // Default memory allocator
+
+ // allocator is read-only, so received samples
+ // cannot be modified (probably only relevant to in-place
+ // transforms
+ BYTE m_bReadOnly;
+
+ // in flushing state (between BeginFlush and EndFlush)
+ // if TRUE, all Receives are returned with S_FALSE
+ BYTE m_bFlushing;
+
+ // Sample properties - initalized in Receive
+ AM_SAMPLE2_PROPERTIES m_SampleProps;
+
+public:
+
+ CBaseInputPin(
+ __in_opt LPCTSTR pObjectName,
+ __in CBaseFilter *pFilter,
+ __in CCritSec *pLock,
+ __inout HRESULT *phr,
+ __in_opt LPCWSTR pName);
+#ifdef UNICODE
+ CBaseInputPin(
+ __in_opt LPCSTR pObjectName,
+ __in CBaseFilter *pFilter,
+ __in CCritSec *pLock,
+ __inout HRESULT *phr,
+ __in_opt LPCWSTR pName);
+#endif
+ virtual ~CBaseInputPin();
+
+ DECLARE_IUNKNOWN
+
+ // override this to publicise our interfaces
+ STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);
+
+ // return the allocator interface that this input pin
+ // would like the output pin to use
+ STDMETHODIMP GetAllocator(__deref_out IMemAllocator ** ppAllocator);
+
+ // tell the input pin which allocator the output pin is actually
+ // going to use.
+ STDMETHODIMP NotifyAllocator(
+ IMemAllocator * pAllocator,
+ BOOL bReadOnly);
+
+ // do something with this media sample
+ STDMETHODIMP Receive(IMediaSample *pSample);
+
+ // do something with these media samples
+ STDMETHODIMP ReceiveMultiple (
+ __in_ecount(nSamples) IMediaSample **pSamples,
+ long nSamples,
+ __out long *nSamplesProcessed);
+
+ // See if Receive() blocks
+ STDMETHODIMP ReceiveCanBlock();
+
+ // Default handling for BeginFlush - call at the beginning
+ // of your implementation (makes sure that all Receive calls
+ // fail). After calling this, you need to free any queued data
+ // and then call downstream.
+ STDMETHODIMP BeginFlush(void);
+
+ // default handling for EndFlush - call at end of your implementation
+ // - before calling this, ensure that there is no queued data and no thread
+ // pushing any more without a further receive, then call downstream,
+ // then call this method to clear the m_bFlushing flag and re-enable
+ // receives
+ STDMETHODIMP EndFlush(void);
+
+ // this method is optional (can return E_NOTIMPL).
+ // default implementation returns E_NOTIMPL. Override if you have
+ // specific alignment or prefix needs, but could use an upstream
+ // allocator
+ STDMETHODIMP GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES*pProps);
+
+ // Release the pin's allocator.
+ HRESULT BreakConnect();
+
+ // helper method to check the read-only flag
+ BOOL IsReadOnly() {
+ return m_bReadOnly;
+ };
+
+ // helper method to see if we are flushing
+ BOOL IsFlushing() {
+ return m_bFlushing;
+ };
+
+ // Override this for checking whether it's OK to process samples
+ // Also call this from EndOfStream.
+ virtual HRESULT CheckStreaming();
+
+ // Pass a Quality notification on to the appropriate sink
+ HRESULT PassNotify(Quality& q);
+
+
+ //================================================================================
+ // IQualityControl methods (from CBasePin)
+ //================================================================================
+
+ STDMETHODIMP Notify(IBaseFilter * pSender, Quality q);
+
+ // no need to override:
+ // STDMETHODIMP SetSink(IQualityControl * piqc);
+
+
+ // switch the pin to inactive state - may already be inactive
+ virtual HRESULT Inactive(void);
+
+ // Return sample properties pointer
+ AM_SAMPLE2_PROPERTIES * SampleProps() {
+ ASSERT(m_SampleProps.cbData != 0);
+ return &m_SampleProps;
+ }
+
+};
+
+///////////////////////////////////////////////////////////////////////////
+// CDynamicOutputPin
+//
+
+class CDynamicOutputPin : public CBaseOutputPin,
+ public IPinFlowControl
+{
+public:
+#ifdef UNICODE
+ CDynamicOutputPin(
+ __in_opt LPCSTR pObjectName,
+ __in CBaseFilter *pFilter,
+ __in CCritSec *pLock,
+ __inout HRESULT *phr,
+ __in_opt LPCWSTR pName);
+#endif
+
+ CDynamicOutputPin(
+ __in_opt LPCTSTR pObjectName,
+ __in CBaseFilter *pFilter,
+ __in CCritSec *pLock,
+ __inout HRESULT *phr,
+ __in_opt LPCWSTR pName);
+
+ ~CDynamicOutputPin();
+
+ // IUnknown Methods
+ DECLARE_IUNKNOWN
+ STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);
+
+ // IPin Methods
+ STDMETHODIMP Disconnect(void);
+
+ // IPinFlowControl Methods
+ STDMETHODIMP Block(DWORD dwBlockFlags, HANDLE hEvent);
+
+ // Set graph config info
+ void SetConfigInfo(IGraphConfig *pGraphConfig, HANDLE hStopEvent);
+
+ #ifdef DEBUG
+ virtual HRESULT Deliver(IMediaSample *pSample);
+ virtual HRESULT DeliverEndOfStream(void);
+ virtual HRESULT DeliverNewSegment(REFERENCE_TIME tStart, REFERENCE_TIME tStop, double dRate);
+ #endif // DEBUG
+
+ HRESULT DeliverBeginFlush(void);
+ HRESULT DeliverEndFlush(void);
+
+ HRESULT Inactive(void);
+ HRESULT Active(void);
+ virtual HRESULT CompleteConnect(IPin *pReceivePin);
+
+ virtual HRESULT StartUsingOutputPin(void);
+ virtual void StopUsingOutputPin(void);
+ virtual bool StreamingThreadUsingOutputPin(void);
+
+ HRESULT ChangeOutputFormat
+ (
+ const AM_MEDIA_TYPE *pmt,
+ REFERENCE_TIME tSegmentStart,
+ REFERENCE_TIME tSegmentStop,
+ double dSegmentRate
+ );
+ HRESULT ChangeMediaType(const CMediaType *pmt);
+ HRESULT DynamicReconnect(const CMediaType *pmt);
+
+protected:
+ HRESULT SynchronousBlockOutputPin(void);
+ HRESULT AsynchronousBlockOutputPin(HANDLE hNotifyCallerPinBlockedEvent);
+ HRESULT UnblockOutputPin(void);
+
+ void BlockOutputPin(void);
+ void ResetBlockState(void);
+
+ static HRESULT WaitEvent(HANDLE hEvent);
+
+ enum BLOCK_STATE
+ {
+ NOT_BLOCKED,
+ PENDING,
+ BLOCKED
+ };
+
+ // This lock should be held when the following class members are
+ // being used: m_hNotifyCallerPinBlockedEvent, m_BlockState,
+ // m_dwBlockCallerThreadID and m_dwNumOutstandingOutputPinUsers.
+ CCritSec m_BlockStateLock;
+
+ // This event should be signaled when the output pin is
+ // not blocked. This is a manual reset event. For more
+ // information on events, see the documentation for
+ // CreateEvent() in the Windows SDK.
+ HANDLE m_hUnblockOutputPinEvent;
+
+ // This event will be signaled when block operation succeedes or
+ // when the user cancels the block operation. The block operation
+ // can be canceled by calling IPinFlowControl2::Block( 0, NULL )
+ // while the block operation is pending.
+ HANDLE m_hNotifyCallerPinBlockedEvent;
+
+ // The state of the current block operation.
+ BLOCK_STATE m_BlockState;
+
+ // The ID of the thread which last called IPinFlowControl::Block().
+ // For more information on thread IDs, see the documentation for
+ // GetCurrentThreadID() in the Windows SDK.
+ DWORD m_dwBlockCallerThreadID;
+
+ // The number of times StartUsingOutputPin() has been sucessfully
+ // called and a corresponding call to StopUsingOutputPin() has not
+ // been made. When this variable is greater than 0, the streaming
+ // thread is calling IPin::NewSegment(), IPin::EndOfStream(),
+ // IMemInputPin::Receive() or IMemInputPin::ReceiveMultiple(). The
+ // streaming thread could also be calling: DynamicReconnect(),
+ // ChangeMediaType() or ChangeOutputFormat(). The output pin cannot
+ // be blocked while the output pin is being used.
+ DWORD m_dwNumOutstandingOutputPinUsers;
+
+ // This event should be set when the IMediaFilter::Stop() is called.
+ // This is a manual reset event. It is also set when the output pin
+ // delivers a flush to the connected input pin.
+ HANDLE m_hStopEvent;
+ IGraphConfig* m_pGraphConfig;
+
+ // TRUE if the output pin's allocator's samples are read only.
+ // Otherwise FALSE. For more information, see the documentation
+ // for IMemInputPin::NotifyAllocator().
+ BOOL m_bPinUsesReadOnlyAllocator;
+
+private:
+ HRESULT Initialize(void);
+ HRESULT ChangeMediaTypeHelper(const CMediaType *pmt);
+
+ #ifdef DEBUG
+ void AssertValid(void);
+ #endif // DEBUG
+};
+
+class CAutoUsingOutputPin
+{
+public:
+ CAutoUsingOutputPin( __in CDynamicOutputPin* pOutputPin, __inout HRESULT* phr );
+ ~CAutoUsingOutputPin();
+
+private:
+ CDynamicOutputPin* m_pOutputPin;
+};
+
+inline CAutoUsingOutputPin::CAutoUsingOutputPin( __in CDynamicOutputPin* pOutputPin, __inout HRESULT* phr ) :
+ m_pOutputPin(NULL)
+{
+ // The caller should always pass in valid pointers.
+ ASSERT( NULL != pOutputPin );
+ ASSERT( NULL != phr );
+
+ // Make sure the user initialized phr.
+ ASSERT( S_OK == *phr );
+
+ HRESULT hr = pOutputPin->StartUsingOutputPin();
+ if( FAILED( hr ) )
+ {
+ *phr = hr;
+ return;
+ }
+
+ m_pOutputPin = pOutputPin;
+}
+
+inline CAutoUsingOutputPin::~CAutoUsingOutputPin()
+{
+ if( NULL != m_pOutputPin )
+ {
+ m_pOutputPin->StopUsingOutputPin();
+ }
+}
+
+#ifdef DEBUG
+
+inline HRESULT CDynamicOutputPin::Deliver(IMediaSample *pSample)
+{
+ // The caller should call StartUsingOutputPin() before calling this
+ // method.
+ ASSERT(StreamingThreadUsingOutputPin());
+
+ return CBaseOutputPin::Deliver(pSample);
+}
+
+inline HRESULT CDynamicOutputPin::DeliverEndOfStream(void)
+{
+ // The caller should call StartUsingOutputPin() before calling this
+ // method.
+ ASSERT( StreamingThreadUsingOutputPin() );
+
+ return CBaseOutputPin::DeliverEndOfStream();
+}
+
+inline HRESULT CDynamicOutputPin::DeliverNewSegment(REFERENCE_TIME tStart, REFERENCE_TIME tStop, double dRate)
+{
+ // The caller should call StartUsingOutputPin() before calling this
+ // method.
+ ASSERT(StreamingThreadUsingOutputPin());
+
+ return CBaseOutputPin::DeliverNewSegment(tStart, tStop, dRate);
+}
+
+#endif // DEBUG
+
+//=====================================================================
+//=====================================================================
+// Memory allocators
+//
+// the shared memory transport between pins requires the input pin
+// to provide a memory allocator that can provide sample objects. A
+// sample object supports the IMediaSample interface.
+//
+// CBaseAllocator handles the management of free and busy samples. It
+// allocates CMediaSample objects. CBaseAllocator is an abstract class:
+// in particular it has no method of initializing the list of free
+// samples. CMemAllocator is derived from CBaseAllocator and initializes
+// the list of samples using memory from the standard IMalloc interface.
+//
+// If you want your buffers to live in some special area of memory,
+// derive your allocator object from CBaseAllocator. If you derive your
+// IMemInputPin interface object from CBaseMemInputPin, you will get
+// CMemAllocator-based allocation etc for free and will just need to
+// supply the Receive handling, and media type / format negotiation.
+//=====================================================================
+//=====================================================================
+
+
+//=====================================================================
+//=====================================================================
+// Defines CMediaSample
+//
+// an object of this class supports IMediaSample and represents a buffer
+// for media data with some associated properties. Releasing it returns
+// it to a freelist managed by a CBaseAllocator derived object.
+//=====================================================================
+//=====================================================================
+
+class CMediaSample : public IMediaSample2 // The interface we support
+{
+
+protected:
+
+ friend class CBaseAllocator;
+
+ /* Values for dwFlags - these are used for backward compatiblity
+ only now - use AM_SAMPLE_xxx
+ */
+ enum { Sample_SyncPoint = 0x01, /* Is this a sync point */
+ Sample_Preroll = 0x02, /* Is this a preroll sample */
+ Sample_Discontinuity = 0x04, /* Set if start of new segment */
+ Sample_TypeChanged = 0x08, /* Has the type changed */
+ Sample_TimeValid = 0x10, /* Set if time is valid */
+ Sample_MediaTimeValid = 0x20, /* Is the media time valid */
+ Sample_TimeDiscontinuity = 0x40, /* Time discontinuity */
+ Sample_StopValid = 0x100, /* Stop time valid */
+ Sample_ValidFlags = 0x1FF
+ };
+
+ /* Properties, the media sample class can be a container for a format
+ change in which case we take a copy of a type through the SetMediaType
+ interface function and then return it when GetMediaType is called. As
+ we do no internal processing on it we leave it as a pointer */
+
+ DWORD m_dwFlags; /* Flags for this sample */
+ /* Type specific flags are packed
+ into the top word
+ */
+ DWORD m_dwTypeSpecificFlags; /* Media type specific flags */
+ __field_ecount_opt(m_cbBuffer) LPBYTE m_pBuffer; /* Pointer to the complete buffer */
+ LONG m_lActual; /* Length of data in this sample */
+ LONG m_cbBuffer; /* Size of the buffer */
+ CBaseAllocator *m_pAllocator; /* The allocator who owns us */
+ CMediaSample *m_pNext; /* Chaining in free list */
+ REFERENCE_TIME m_Start; /* Start sample time */
+ REFERENCE_TIME m_End; /* End sample time */
+ LONGLONG m_MediaStart; /* Real media start position */
+ LONG m_MediaEnd; /* A difference to get the end */
+ AM_MEDIA_TYPE *m_pMediaType; /* Media type change data */
+ DWORD m_dwStreamId; /* Stream id */
+public:
+ LONG m_cRef; /* Reference count */
+
+
+public:
+
+ CMediaSample(
+ __in_opt LPCTSTR pName,
+ __in_opt CBaseAllocator *pAllocator,
+ __inout_opt HRESULT *phr,
+ __in_bcount_opt(length) LPBYTE pBuffer = NULL,
+ LONG length = 0);
+#ifdef UNICODE
+ CMediaSample(
+ __in_opt LPCSTR pName,
+ __in_opt CBaseAllocator *pAllocator,
+ __inout_opt HRESULT *phr,
+ __in_bcount_opt(length) LPBYTE pBuffer = NULL,
+ LONG length = 0);
+#endif
+
+ virtual ~CMediaSample();
+
+ /* Note the media sample does not delegate to its owner */
+
+ STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv);
+ STDMETHODIMP_(ULONG) AddRef();
+ STDMETHODIMP_(ULONG) Release();
+
+ // set the buffer pointer and length. Used by allocators that
+ // want variable sized pointers or pointers into already-read data.
+ // This is only available through a CMediaSample* not an IMediaSample*
+ // and so cannot be changed by clients.
+ HRESULT SetPointer(__in_bcount(cBytes) BYTE * ptr, LONG cBytes);
+
+ // Get me a read/write pointer to this buffer's memory.
+ STDMETHODIMP GetPointer(__deref_out BYTE ** ppBuffer);
+
+ STDMETHODIMP_(LONG) GetSize(void);
+
+ // get the stream time at which this sample should start and finish.
+ STDMETHODIMP GetTime(
+ __out REFERENCE_TIME * pTimeStart, // put time here
+ __out REFERENCE_TIME * pTimeEnd
+ );
+
+ // Set the stream time at which this sample should start and finish.
+ STDMETHODIMP SetTime(
+ __in_opt REFERENCE_TIME * pTimeStart, // put time here
+ __in_opt REFERENCE_TIME * pTimeEnd
+ );
+ STDMETHODIMP IsSyncPoint(void);
+ STDMETHODIMP SetSyncPoint(BOOL bIsSyncPoint);
+ STDMETHODIMP IsPreroll(void);
+ STDMETHODIMP SetPreroll(BOOL bIsPreroll);
+
+ STDMETHODIMP_(LONG) GetActualDataLength(void);
+ STDMETHODIMP SetActualDataLength(LONG lActual);
+
+ // these allow for limited format changes in band
+
+ STDMETHODIMP GetMediaType(__deref_out AM_MEDIA_TYPE **ppMediaType);
+ STDMETHODIMP SetMediaType(__in_opt AM_MEDIA_TYPE *pMediaType);
+
+ // returns S_OK if there is a discontinuity in the data (this same is
+ // not a continuation of the previous stream of data
+ // - there has been a seek).
+ STDMETHODIMP IsDiscontinuity(void);
+ // set the discontinuity property - TRUE if this sample is not a
+ // continuation, but a new sample after a seek.
+ STDMETHODIMP SetDiscontinuity(BOOL bDiscontinuity);
+
+ // get the media times for this sample
+ STDMETHODIMP GetMediaTime(
+ __out LONGLONG * pTimeStart,
+ __out LONGLONG * pTimeEnd
+ );
+
+ // Set the media times for this sample
+ STDMETHODIMP SetMediaTime(
+ __in_opt LONGLONG * pTimeStart,
+ __in_opt LONGLONG * pTimeEnd
+ );
+
+ // Set and get properties (IMediaSample2)
+ STDMETHODIMP GetProperties(
+ DWORD cbProperties,
+ __out_bcount(cbProperties) BYTE * pbProperties
+ );
+
+ STDMETHODIMP SetProperties(
+ DWORD cbProperties,
+ __in_bcount(cbProperties) const BYTE * pbProperties
+ );
+};
+
+
+//=====================================================================
+//=====================================================================
+// Defines CBaseAllocator
+//
+// Abstract base class that manages a list of media samples
+//
+// This class provides support for getting buffers from the free list,
+// including handling of commit and (asynchronous) decommit.
+//
+// Derive from this class and override the Alloc and Free functions to
+// allocate your CMediaSample (or derived) objects and add them to the
+// free list, preparing them as necessary.
+//=====================================================================
+//=====================================================================
+
+class AM_NOVTABLE CBaseAllocator : public CUnknown,// A non delegating IUnknown
+ public IMemAllocatorCallbackTemp, // The interface we support
+ public CCritSec // Provides object locking
+{
+ class CSampleList;
+ friend class CSampleList;
+
+ /* Trick to get at protected member in CMediaSample */
+ static CMediaSample * &NextSample(__in CMediaSample *pSample)
+ {
+ return pSample->m_pNext;
+ };
+
+ /* Mini list class for the free list */
+ class CSampleList
+ {
+ public:
+ CSampleList() : m_List(NULL), m_nOnList(0) {};
+#ifdef DEBUG
+ ~CSampleList()
+ {
+ ASSERT(m_nOnList == 0);
+ };
+#endif
+ CMediaSample *Head() const { return m_List; };
+ CMediaSample *Next(__in CMediaSample *pSample) const { return CBaseAllocator::NextSample(pSample); };
+ int GetCount() const { return m_nOnList; };
+ void Add(__inout CMediaSample *pSample)
+ {
+ ASSERT(pSample != NULL);
+ CBaseAllocator::NextSample(pSample) = m_List;
+ m_List = pSample;
+ m_nOnList++;
+ };
+ CMediaSample *RemoveHead()
+ {
+ CMediaSample *pSample = m_List;
+ if (pSample != NULL) {
+ m_List = CBaseAllocator::NextSample(m_List);
+ m_nOnList--;
+ }
+ return pSample;
+ };
+ void Remove(__inout CMediaSample *pSample);
+
+ public:
+ CMediaSample *m_List;
+ int m_nOnList;
+ };
+protected:
+
+ CSampleList m_lFree; // Free list
+
+ /* Note to overriders of CBaseAllocator.
+
+ We use a lazy signalling mechanism for waiting for samples.
+ This means we don't call the OS if no waits occur.
+
+ In order to implement this:
+
+ 1. When a new sample is added to m_lFree call NotifySample() which
+ calls ReleaseSemaphore on m_hSem with a count of m_lWaiting and
+ sets m_lWaiting to 0.
+ This must all be done holding the allocator's critical section.
+
+ 2. When waiting for a sample call SetWaiting() which increments
+ m_lWaiting BEFORE leaving the allocator's critical section.
+
+ 3. Actually wait by calling WaitForSingleObject(m_hSem, INFINITE)
+ having left the allocator's critical section. The effect of
+ this is to remove 1 from the semaphore's count. You MUST call
+ this once having incremented m_lWaiting.
+
+ The following are then true when the critical section is not held :
+ (let nWaiting = number about to wait or waiting)
+
+ (1) if (m_lFree.GetCount() != 0) then (m_lWaiting == 0)
+ (2) m_lWaiting + Semaphore count == nWaiting
+
+ We would deadlock if
+ nWaiting != 0 &&
+ m_lFree.GetCount() != 0 &&
+ Semaphore count == 0
+
+ But from (1) if m_lFree.GetCount() != 0 then m_lWaiting == 0 so
+ from (2) Semaphore count == nWaiting (which is non-0) so the
+ deadlock can't happen.
+ */
+
+ HANDLE m_hSem; // For signalling
+ long m_lWaiting; // Waiting for a free element
+ long m_lCount; // how many buffers we have agreed to provide
+ long m_lAllocated; // how many buffers are currently allocated
+ long m_lSize; // agreed size of each buffer
+ long m_lAlignment; // agreed alignment
+ long m_lPrefix; // agreed prefix (preceeds GetPointer() value)
+ BOOL m_bChanged; // Have the buffer requirements changed
+
+ // if true, we are decommitted and can't allocate memory
+ BOOL m_bCommitted;
+ // if true, the decommit has happened, but we haven't called Free yet
+ // as there are still outstanding buffers
+ BOOL m_bDecommitInProgress;
+
+ // Notification interface
+ IMemAllocatorNotifyCallbackTemp *m_pNotify;
+
+ BOOL m_fEnableReleaseCallback;
+
+ // called to decommit the memory when the last buffer is freed
+ // pure virtual - need to override this
+ virtual void Free(void) PURE;
+
+ // override to allocate the memory when commit called
+ virtual HRESULT Alloc(void);
+
+public:
+
+ CBaseAllocator(
+ __in_opt LPCTSTR , __inout_opt LPUNKNOWN, __inout HRESULT *,
+ BOOL bEvent = TRUE, BOOL fEnableReleaseCallback = FALSE);
+#ifdef UNICODE
+ CBaseAllocator(
+ __in_opt LPCSTR , __inout_opt LPUNKNOWN, __inout HRESULT *,
+ BOOL bEvent = TRUE, BOOL fEnableReleaseCallback = FALSE);
+#endif
+ virtual ~CBaseAllocator();
+
+ DECLARE_IUNKNOWN
+
+ // override this to publicise our interfaces
+ STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv);
+
+ STDMETHODIMP SetProperties(
+ __in ALLOCATOR_PROPERTIES* pRequest,
+ __out ALLOCATOR_PROPERTIES* pActual);
+
+ // return the properties actually being used on this allocator
+ STDMETHODIMP GetProperties(
+ __out ALLOCATOR_PROPERTIES* pProps);
+
+ // override Commit to allocate memory. We handle the GetBuffer
+ //state changes
+ STDMETHODIMP Commit();
+
+ // override this to handle the memory freeing. We handle any outstanding
+ // GetBuffer calls
+ STDMETHODIMP Decommit();
+
+ // get container for a sample. Blocking, synchronous call to get the
+ // next free buffer (as represented by an IMediaSample interface).
+ // on return, the time etc properties will be invalid, but the buffer
+ // pointer and size will be correct. The two time parameters are
+ // optional and either may be NULL, they may alternatively be set to
+ // the start and end times the sample will have attached to it
+ // bPrevFramesSkipped is not used (used only by the video renderer's
+ // allocator where it affects quality management in direct draw).
+
+ STDMETHODIMP GetBuffer(__deref_out IMediaSample **ppBuffer,
+ __in_opt REFERENCE_TIME * pStartTime,
+ __in_opt REFERENCE_TIME * pEndTime,
+ DWORD dwFlags);
+
+ // final release of a CMediaSample will call this
+ STDMETHODIMP ReleaseBuffer(IMediaSample *pBuffer);
+ // obsolete:: virtual void PutOnFreeList(CMediaSample * pSample);
+
+ STDMETHODIMP SetNotify(IMemAllocatorNotifyCallbackTemp *pNotify);
+
+ STDMETHODIMP GetFreeCount(__out LONG *plBuffersFree);
+
+ // Notify that a sample is available
+ void NotifySample();
+
+ // Notify that we're waiting for a sample
+ void SetWaiting() { m_lWaiting++; };
+};
+
+
+//=====================================================================
+//=====================================================================
+// Defines CMemAllocator
+//
+// this is an allocator based on CBaseAllocator that allocates sample
+// buffers in main memory (from 'new'). You must call SetProperties
+// before calling Commit.
+//
+// we don't free the memory when going into Decommit state. The simplest
+// way to implement this without complicating CBaseAllocator is to
+// have a Free() function, called to go into decommit state, that does
+// nothing and a ReallyFree function called from our destructor that
+// actually frees the memory.
+//=====================================================================
+//=====================================================================
+
+// Make me one from quartz.dll
+STDAPI CreateMemoryAllocator(__deref_out IMemAllocator **ppAllocator);
+
+class CMemAllocator : public CBaseAllocator
+{
+
+protected:
+
+ LPBYTE m_pBuffer; // combined memory for all buffers
+
+ // override to free the memory when decommit completes
+ // - we actually do nothing, and save the memory until deletion.
+ void Free(void);
+
+ // called from the destructor (and from Alloc if changing size/count) to
+ // actually free up the memory
+ void ReallyFree(void);
+
+ // overriden to allocate the memory when commit called
+ HRESULT Alloc(void);
+
+public:
+ /* This goes in the factory template table to create new instances */
+ static CUnknown *CreateInstance(__inout_opt LPUNKNOWN, __inout HRESULT *);
+
+ STDMETHODIMP SetProperties(
+ __in ALLOCATOR_PROPERTIES* pRequest,
+ __out ALLOCATOR_PROPERTIES* pActual);
+
+ CMemAllocator(__in_opt LPCTSTR , __inout_opt LPUNKNOWN, __inout HRESULT *);
+#ifdef UNICODE
+ CMemAllocator(__in_opt LPCSTR , __inout_opt LPUNKNOWN, __inout HRESULT *);
+#endif
+ ~CMemAllocator();
+};
+
+// helper used by IAMovieSetup implementation
+STDAPI
+AMovieSetupRegisterFilter( const AMOVIESETUP_FILTER * const psetupdata
+ , IFilterMapper * pIFM
+ , BOOL bRegister );
+
+
+///////////////////////////////////////////////////////////////////////////
+// ------------------------------------------------------------------------
+// ------------------------------------------------------------------------
+// ------------------------------------------------------------------------
+// ------------------------------------------------------------------------
+///////////////////////////////////////////////////////////////////////////
+
+#endif /* __FILTER__ */
+
+
+